CAS Number4126-60-7
SynonymsMethyl 3-(benzyloxy)propanoate; 3-Benzyloxy-propionsaeure-methylester; Propionic acid,3-(benzyloxy)-,methyl ester; Propanoic acid, 3-(phenylmethoxy)-, methyl ester; 3-(benzyloxy)propanoic acid methyl ester; Propionic acid, 3-(benzyloxy)-, methyl ester; Propanoic acid, 3- (phenylmethoxy)-, methyl ester; Propionic acid, 3- (benzyloxy)-, methyl ester
Molecular FormulaC11H14O3
Molecular Weight194.227
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point284.2±15.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4126-60-7 |
| Catalog No. | 2A-0127932 |
| Chinese Name | 3-苄氧基丙酸甲酯 |
| Synonyms | Methyl 3-(benzyloxy)propanoate; 3-Benzyloxy-propionsaeure-methylester; Propionic acid,3-(benzyloxy)-,methyl ester; Propanoic acid, 3-(phenylmethoxy)-, methyl ester; 3-(benzyloxy)propanoic acid methyl ester; Propionic acid, 3-(benzyloxy)-, methyl ester; Propanoic acid, 3- (phenylmethoxy)-, methyl ester; Propionic acid, 3- (benzyloxy)-, methyl ester |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.227 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 284.2±15.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 112621 |
| SMILES | COC(=O)CCOCc1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-13-11(12)7-8-14-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChI Key | PLLAGNDLRNXFLU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(BENZYLOXY)-1-PHENYLPROPAN-1-ONE | 37951-47-6 | 2A-0127908 |
| 3-(BENZYLOXY)-4'-METHOXY-1,1'-BIPHENYL | 132470-28-1 | 2A-0127913 |
| 3-(BENZYLOXY)-4-METHYLBENZOIC ACID | 165662-68-0 | 2A-0127915 |
| 3-(BENZYLOXY)-6-BROMO-2-FLUOROPHENOL | 1228956-98-6 | 2A-0127924 |
| 3-(BENZYLOXY)CYCLOBUTANONE | 30830-27-4 | 2A-1127929 |
| 3-(BIS(2-CHLOROETHYL)AMINO)BENZONITRILE | 24813-12-5 | 2A-0127936 |
| 3-(BIS(2-HYDROXYETHYL)AMINO)PROPANENITRILE | 17209-72-2 | 2A-0127937 |
| 3-(CARBOXYMETHYL)BENZOIC ACID | 2084-13-1 | 2A-0127980 |
| 3-(CYCLOHEXYLAMINO)-4-ETHOXYCYCLOBUT-3-ENE-1,2-DIONE | 175204-28-1 | 2A-0128034 |
| 3-(CYCLOHEXYLOXY)PROPAN-1-AMINE | 16728-63-5 | 2A-0128038 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS