
CAS Number30830-27-4
Synonyms3-phenylmethyloxycyclobutanone; 3-(phenylmethoxy)cyclobutan-1-one; 3-(benzyloxy)cyclobutan-1-one; 3-(Benzyloxy)cyclobutanone; CYCLOBUTANONE,3-(PHENYLMETHOXY)
Molecular FormulaC11H12O2
Molecular Weight188.27
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point284.8±33.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Yellow clear liquid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30830-27-4 |
| Catalog No. | 2A-1127929 |
| Chinese Name | 3-(苄氧基)环丁酮 |
| Synonyms | 3-phenylmethyloxycyclobutanone; 3-(phenylmethoxy)cyclobutan-1-one; 3-(benzyloxy)cyclobutan-1-one; 3-(Benzyloxy)cyclobutanone; CYCLOBUTANONE,3-(PHENYLMETHOXY) |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 188.27 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 284.8±33.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Yellow clear liquid |
| Storage Condition | 0-10°C; store under inert gas; avoid moisture (dec |
| EINECS | 0 |
| HTC | 2914509090 |
| UN(IATA) | 0 |
| PubChem ID | 329817287 |
| MDL Number | MFCD01719186 |
| SMILES | O=C1CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C11H12O2/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2 |
| InChI Key | GPPSQLLIFNWNSB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352116 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(BENZYLAMINO)PROPANOIC ACID | 5426-62-0 | 2A-0127905 |
| 3-(BENZYLOXY)-1-PHENYLPROPAN-1-ONE | 37951-47-6 | 2A-0127908 |
| 3-(BENZYLOXY)-4'-METHOXY-1,1'-BIPHENYL | 132470-28-1 | 2A-0127913 |
| 3-(BENZYLOXY)-4-METHYLBENZOIC ACID | 165662-68-0 | 2A-0127915 |
| 3-(BENZYLOXY)-6-BROMO-2-FLUOROPHENOL | 1228956-98-6 | 2A-0127924 |
| 3-(BENZYLOXY)PROPIONIC ACID METHYL ESTER | 4126-60-7 | 2A-0127932 |
| 3-(BIS(2-CHLOROETHYL)AMINO)BENZONITRILE | 24813-12-5 | 2A-0127936 |
| 3-(BIS(2-HYDROXYETHYL)AMINO)PROPANENITRILE | 17209-72-2 | 2A-0127937 |
| 3-(CARBOXYMETHYL)BENZOIC ACID | 2084-13-1 | 2A-0127980 |
| 3-(CYCLOHEXYLAMINO)-4-ETHOXYCYCLOBUT-3-ENE-1,2-DIONE | 175204-28-1 | 2A-0128034 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA