
CAS Number115103-54-3
Synonyms(-)-(R)-1-[4,4-Bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid hydrochloride; (R)-(-)-N-(4,4-di(3-methylthien-2-yl)but-3-enyl)nipecotic acid; acide (3R)-1-[4,4-bis(3-méthylthiophén-2-yl)but-3-én-1-yl]pipéridine-3-carboxylique chlorhydrate; NO-05-0328; Gabitril / NNC 05-328; Abbott-70569.1; (R)-N-[4,4-di-(3-methylthien-2-yl)but-3-enyl] nipecotic acid hydrochloride; (3R)-1-[4,4-Bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid hydrochloride (1:1); (3R)-1-[4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidin-3-carbonsäurehydrochlorid; TIGABINE; (R)-1-[4,4-bis(3-methyl-thien-2-yl)-3-butenyl]-3-piperidinecarboxylic acid; (3R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)-3-piperidinecarboxylic acid hydrochloride; (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidine-3-car
Molecular FormulaC20H25O2N1S2
Molecular Weight375.56
Purity99%
Density1.208 g/cm3
Boiling Point568ºC at 760 mmHg
Melting Point192oC dec.
AppearanceWhite to off-white crystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115103-54-3 |
| Catalog No. | 2A-9012701 |
| Chinese Name | 噻加宾 |
| Synonyms | (-)-(R)-1-[4,4-Bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid hydrochloride; (R)-(-)-N-(4,4-di(3-methylthien-2-yl)but-3-enyl)nipecotic acid; acide (3R)-1-[4,4-bis(3-méthylthiophén-2-yl)but-3-én-1-yl]pipéridine-3-carboxylique chlorhydrate; NO-05-0328; Gabitril / NNC 05-328; Abbott-70569.1; (R)-N-[4,4-di-(3-methylthien-2-yl)but-3-enyl] nipecotic acid hydrochloride; (3R)-1-[4,4-Bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid hydrochloride (1:1); (3R)-1-[4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidin-3-carbonsäurehydrochlorid; TIGABINE; (R)-1-[4,4-bis(3-methyl-thien-2-yl)-3-butenyl]-3-piperidinecarboxylic acid; (3R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)-3-piperidinecarboxylic acid hydrochloride; (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidine-3-car |
| Molecular Formula | C20H25O2N1S2 |
| Molecular Weight | 375.56 |
| Purity | 99 |
| Density | 1.208 g/cm3 |
| Boiling Point | 568ºC at 760 mmHg |
| Melting Point | 192oC dec. |
| Appearance | White to off-white crystalline solid |
| Storage Condition | -20℃ |
| Application | Tiagabine (NO328) is a GABA reabsorption inhibitor. |
| MDL Number | MFCD00865317 |
| SMILES | Cc1ccsc1C(=CCCN1CCCC(C(=O)O)C1)c1sccc1C |
| InChI | InChI=1S/C20H25NO2S2/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChI Key | PBJUNZJWGZTSKL-MRXNPFEDSA-N |
| MSDS | msds/12701_1_115103_54_3.pdf |
| Transport Info | Product Name: Tigabine Hydrochloride |
| Location | 25 days |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Thymopentin | 69558-55-0 | 2A-9012696 |
| Thymotrinan | 85465-82-3 | 2A-9012697 |
| Thymoxamine | 54-32-0 | 2A-9012698 |
| Tiadenol | 6964-20-1 | 2A-9012699 |
| Tiafibrate | 55837-28-0 | 2A-9012700 |
| Tiamenidine | 31428-61-2 | 2A-9012702 |
| Tiametonium iodide | 10433-71-3 | 2A-9012703 |
| Tianeptine | 66981-73-5 | 2A-9012704 |
| Tiapamil | 57010-31-8 | 2A-9012706 |
| Tibalosin | 63996-84-9 | 2A-9012708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA