
CAS Number14636-12-5
SynonymsTerlipressin; EINECS 238-680-8; MFCD00155450; N-(N-(N-Glycylglycyl)glycyl)-8-L-lysinevasopressin; Terlipressin Acetate
Molecular FormulaC52H74N16O15S2
Molecular Weight1227.37 (free base basis)
Purity≥95 (HPLC)%
Density1.5±0.1 g/cm3
Boiling Point1824.0±65.0 °C at 760 mmHg
Appearancelyophilized powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14636-12-5 |
| Catalog No. | 2A-9012649 |
| Chinese Name | 特利加压素 |
| Synonyms | Terlipressin; EINECS 238-680-8; MFCD00155450; N-(N-(N-Glycylglycyl)glycyl)-8-L-lysinevasopressin; Terlipressin Acetate |
| Molecular Formula | C52H74N16O15S2 |
| Molecular Weight | 1227.37 (free base basis) |
| Purity | ≥95 (HPLC) |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1824.0±65.0 °C at 760 mmHg |
| Appearance | lyophilized powder |
| Storage Condition | -20°C |
| Application | Terlipressin is a strong vasoconstrictor that can pass through the receptor V1 on the smooth muscle cells of arterioles. |
| SMILES | S1SC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C1)C(=O)N4[C@@H](CCC4)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N)Cc3ccccc3)Cc2ccc(cc2)O)NC(=O)CNC(=O)CNC(=O)CN.OC(=O)C.OC(=O)C |
| InChI | 1S/C52H74N16O15S2.2C2H4O2/c53-17-5-4-9-31(45(76)60-23-41(57)72)63-51(82)38-10-6-18-68(38)52(83)37-27-85-84-26-36(61-44(75)25-59-43(74)24-58-42(73)22-54)50(81)65-34(20-29-11-13-30(69)14-12-29)48(79)64-33(19-28-7-2-1-3-8-28)47(78)62-32(15-16-39(55)70)46(77)66-35(21-40(56)71)49(80)67-37;2*1-2(3)4/h1-3,7-8,11-14,31-38,69H,4-6,9-10,15-27,53-54H2,(H2,55,70)(H2,56,71)(H2,57,72)(H,58,73)(H,59,74)(H,60,76)(H,61,75)(H,62,78)(H,63,82)(H,64,79)(H,65,81)(H,66,77)(H,67,80);2*1H3,(H,3,4)/t31-,32-,33-,34-,35-,36-,37-,38-;;/m0../s1 |
| InChI Key | WNFVFDPQEHRNTC-LWCZBKQBSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/12649_1_14636_12_5.pdf |
| Transport Info | Product name: Terlipressin Acetate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tererstigmine | 147650-57-5 | 2A-9012644 |
| Terfenadine | 50679-08-8 | 2A-9012645 |
| Terikalant | 132338-79-5 | 2A-9012646 |
| Terizidone | 25683-71-0 | 2A-9012647 |
| Terlakiren | 119625-78-4 | 2A-9012648 |
| Ternidazole | 1077-93-6 | 2A-9012650 |
| Terpinyl acetate | 80-26-2 | 2A-9012651 |
| Tertatolol | 34784-64-0 | 2A-9012652 |
| Testolactone | 968-93-4 | 2A-9012653 |
| Tetracaine Hydrochloride | 136-47-0 | 2A-9012654 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA