
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 588681-49-6 |
| Catalog No. | 2A-0125935 |
| Chinese Name | 3-[(2-氯-4-氟苄基)氧基]苯甲醛 |
| Molecular Formula | C14H10ClFO2 |
| Molecular Weight | 280.49 |
| Purity | 96+ |
| Density | 1.31g/cm3 |
| Boiling Point | 386ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 7680236 |
| SMILES | O=Cc1cccc(OCc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C14H10ClFO2/c15-14-7-12(16)5-4-11(14)9-18-13-3-1-2-10(6-13)8-17/h1-8H,9H2 |
| InChI Key | LBATYTBQYKAONS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,6-DICHLOROBENZO[B]THIOPHENE-2-CARBOHYDRAZIDE | 329219-49-0 | 2A-0125699 |
| 3,6-DIFLUORO-2-METHOXYBENZALDEHYDE | 887267-04-1 | 2A-0125711 |
| 3,9-DIAZASPIRO[5.5]UNDECAN-2-ONE | 867006-20-0 | 2A-0125763 |
| 3-((2,6-DICHLOROBENZYL)OXY)BENZALDEHYDE | 328062-72-2 | 2A-0125880 |
| 3-((2-CHLORO-4-FLUOROBENZYL)OXY)-4-METHOXYBENZALDEHYDE | 588681-50-9 | 2A-0125934 |
| 3-((2-CHLOROBENZYL)OXY)-4-METHOXYBENZALDEHYDE | 341942-09-4 | 2A-0125947 |
| 3-((2-FLUOROBENZYL)OXY)-4-METHOXYBENZALDEHYDE | 384857-20-9 | 2A-0125956 |
| 3-((2-METHYLBENZYL)OXY)BENZALDEHYDE | 590350-87-1 | 2A-0125979 |
| 3-((3,4-DICHLOROBENZYL)OXY)BENZALDEHYDE | 588715-60-0 | 2A-0125994 |
| 3-((3-(TRIFLUOROMETHYL)BENZYL)OXY)BENZALDEHYDE | 343604-08-0 | 2A-0126010 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA