
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 887267-04-1 |
| Catalog No. | 2A-0125711 |
| Chinese Name | 3,6-二氟-2-甲氧基苯甲醛 |
| Synonyms | VHR BF EF FO1; pc1143; 3,6-Difluoro-2-methoxybenzaldehyde; cl8301 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 224.8±35.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 59924847 |
| SMILES | COc1c(F)ccc(F)c1C=O |
| InChI | InChI=1S/C8H6F2O2/c1-12-8-5(4-11)6(9)2-3-7(8)10/h2-4H,1H3 |
| InChI Key | CRIGYCXILOWIKP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-DIMETHYLPHENYLBORONIC ACID | 172975-69-8 | 2A-1125630 |
| 3,5-DIMETHYLPICOLINALDEHYDE | 675138-02-0 | 2A-0125632 |
| 3,6-DIBROMO-2-FLUOROBENZALDEHYDE | 870703-68-7 | 2A-0125671 |
| 3,6-DICHLOROBENZENE-1,2,4-TRICARBOXYLIC ACID | 137071-78-4 | 2A-0125698 |
| 3,6-DICHLOROBENZO[B]THIOPHENE-2-CARBOHYDRAZIDE | 329219-49-0 | 2A-0125699 |
| 3,9-DIAZASPIRO[5.5]UNDECAN-2-ONE | 867006-20-0 | 2A-0125763 |
| 3-((2,6-DICHLOROBENZYL)OXY)BENZALDEHYDE | 328062-72-2 | 2A-0125880 |
| 3-((2-CHLORO-4-FLUOROBENZYL)OXY)-4-METHOXYBENZALDEHYDE | 588681-50-9 | 2A-0125934 |
| 3-((2-CHLORO-4-FLUOROBENZYL)OXY)BENZALDEHYDE | 588681-49-6 | 2A-0125935 |
| 3-((2-CHLOROBENZYL)OXY)-4-METHOXYBENZALDEHYDE | 341942-09-4 | 2A-0125947 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA