
CAS Number4429-63-4
SynonymsEINECS 224-615-0; (-)-Tabersonine; TABERSONINE; Methyl (5α,19α)-2,3,6,7-tetradehydroaspidospermidine-3-carboxylate; methyl 2,3,6,7-tetradehydro-5α,12β,19α-aspidospermidine-3-carboxylate
Molecular FormulaC21H24N2O2
Molecular Weight336.43
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point488.7±45.0 °C at 760 mmHg
AppearanceYellow to brown powder, spicy smell
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4429-63-4 |
| Catalog No. | 2A-9012560 |
| Chinese Name | 它波宁/ 水甘草碱 |
| Synonyms | EINECS 224-615-0; (-)-Tabersonine; TABERSONINE; Methyl (5α,19α)-2,3,6,7-tetradehydroaspidospermidine-3-carboxylate; methyl 2,3,6,7-tetradehydro-5α,12β,19α-aspidospermidine-3-carboxylate |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 488.7±45.0 °C at 760 mmHg |
| Appearance | Yellow to brown powder, spicy smell |
| Storage Condition | Keep away from light, ventilated and dry, sealed |
| Application | Tabersonine is an indole alkaloid isolated primarily from roses. Tabersonine disrupts Aβ(1-42) aggregation and improves Aβ aggregation-induced cytotoxicity. Tabersonine has anti-inflammatory activity |
| MDL Number | C21H24N2O2 |
| SMILES | CCC12C=CCN3CCC4(C(=C(C(=O)OC)C1)Nc1ccccc14)C32 |
| InChI | InChI=1S/C21H24N2O2/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2/h4-9,19,22H,3,10-13H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChI Key | FNGGIPWAZSFKCN-ACRUOGEOSA-N |
| MSDS | msds/12560_1_4429_63_4.pdf |
| Transport Info | Product name: Taponin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sutilains | 12211-28-8 | 2A-9012554 |
| Suxethonium chloride | 54063-57-9 | 2A-9012555 |
| Suxibuzone | 27470-51-5 | 2A-9012556 |
| Swep | 1918-18-9 | 2A-9012558 |
| T-2 toxin | 21259-20-1 | 2A-9012559 |
| Tabilautide | 78088-46-7 | 2A-9012561 |
| Tacalcitol | 57333-96-7 | 2A-9012562 |
| Tadanafil | 171596-29-5 | 2A-9012564 |
| Talampicillin | 47747-56-8 | 2A-9012565 |
| Talbutal | 115-44-6 | 2A-9012566 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA