
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62899-78-9 |
| Catalog No. | 2A-0125439 |
| Chinese Name | 3,5-二氯苯酰肼 |
| Synonyms | MFCD00833411; 3,5-dichlorobenzoic acid hydrazide; 3,5-Dichlorobenzhydrazide; 3,5-dichlorobenzenecarbohydrazide |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04100 |
| Purity | 96+ |
| Density | 1.455 g/cm3 |
| Melting Point | 205 °C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| EINECS | 0 |
| HTC | 2928000090 |
| UN(IATA) | 0 |
| PubChem ID | 3158823 |
| SMILES | NNC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2N2O/c8-5-1-4(7(12)11-10)2-6(9)3-5/h1-3H,10H2,(H,11,12) |
| InChI Key | DNISXKBKTSHNKL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-DIBROMOPICOLINALDEHYDE | 898559-25-6 | 2A-0125374 |
| 3,5-DICHLORO-2-ETHOXYBENZALDEHYDE | 309718-08-9 | 2A-0125389 |
| 3,5-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE | 496052-55-2 | 2A-0125405 |
| 3,5-DICHLORO-4-FLUOROBENZALDEHYDE | 117820-80-1 | 2A-0125407 |
| 3,5-DICHLORO-4-HYDROXYBENZOHYDRAZIDE | 23964-29-6 | 2A-0125413 |
| 3,5-DICHLOROPHENYLBORONIC ACID | 67492-50-6 | 2A-0125449 |
| 3,5-DICHLOROPICOLINALDEHYDE | 471909-65-6 | 2A-0125451 |
| 3,5-DIFLUORO-2-HYDROXYBENZALDEHYDE | 63954-77-8 | 2A-0125467 |
| 3,5-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE | 870717-92-3 | 2A-0125476 |
| 3,5-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID | 261945-09-9 | 2A-0125482 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA