
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 309718-08-9 |
| Catalog No. | 2A-0125389 |
| Chinese Name | 3,5-二氯-2-乙氧基苯甲醛 |
| Synonyms | Benzaldehyde,3,5-dichloro-2-ethoxy |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 265.05 |
| Purity | 96+ |
| EINECS | 259-416-8 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 24893891 |
| MDL Number | MFCD00009798 |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C9H8Cl2O2/c1-2-13-9-6(5-12)3-7(10)4-8(9)11/h3-5H,2H2,1H3 |
| InChI Key | TYAUZCVQOQWESM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 3640643 |
| NACRES Code | NA.47 |
| UNSPSC | 12171500 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-BIS(TRIFLUOROMETHYL)-1,2-DIAMINOBENZENE | 367-65-7 | 2A-0125271 |
| 3,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDIN-2-OL | 109919-34-8 | 2A-0125336 |
| 3,5-DIBROMO-4-ISOPROPOXYBENZALDEHYDE | 486996-44-5 | 2A-0125342 |
| 3,5-DIBROMO-4-METHOXYBENZALDEHYDE | 108940-96-1 | 2A-0125343 |
| 3,5-DIBROMOPICOLINALDEHYDE | 898559-25-6 | 2A-0125374 |
| 3,5-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE | 496052-55-2 | 2A-0125405 |
| 3,5-DICHLORO-4-FLUOROBENZALDEHYDE | 117820-80-1 | 2A-0125407 |
| 3,5-DICHLORO-4-HYDROXYBENZOHYDRAZIDE | 23964-29-6 | 2A-0125413 |
| 3,5-DICHLOROBENZOHYDRAZIDE | 62899-78-9 | 2A-0125439 |
| 3,5-DICHLOROPHENYLBORONIC ACID | 67492-50-6 | 2A-0125449 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA