
CAS Number14542-71-3
Synonyms2,6-DIBROMO-4-METHOXYTOLUENE; EINECS 238-576-2; Anisole,3,5-dibromo-4-methyl; 3,5-Dibromo-4-methylphenyl methyl ether; 1,3-dibromo-2-methyl-5-methoxybenzene; 2,5-BIS(TRIFLUOROMETHYL)BROMOBENZENE; 3,5-Dibromo-4-methylanisole; 2,6-Dibrom-4-methoxytoluol; 1,3-Dibrom-5-methoxy-2-methylbenzol; 1,3-Dibromo-5-methoxy-2-methylbenzene
Molecular FormulaC8H8Br2O
Molecular Weight279.96
Purity96+%
Density1.7±0.1 g/cm3
Boiling Point271.1±35.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14542-71-3 |
| Catalog No. | 2A-0125347 |
| Chinese Name | 2,6-二溴-4-甲氧基甲苯 |
| Synonyms | 2,6-DIBROMO-4-METHOXYTOLUENE; EINECS 238-576-2; Anisole,3,5-dibromo-4-methyl; 3,5-Dibromo-4-methylphenyl methyl ether; 1,3-dibromo-2-methyl-5-methoxybenzene; 2,5-BIS(TRIFLUOROMETHYL)BROMOBENZENE; 3,5-Dibromo-4-methylanisole; 2,6-Dibrom-4-methoxytoluol; 1,3-Dibrom-5-methoxy-2-methylbenzol; 1,3-Dibromo-5-methoxy-2-methylbenzene |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 |
| Purity | 96+ |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 271.1±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 0 |
| HTC | 2909309090 |
| UN(IATA) | 0 |
| PubChem ID | 4608005 |
| MDL Number | MFCD00013526 |
| SMILES | COc1cc(Br)c(C)c(Br)c1 |
| InChI | InChI=1S/C8H8Br2O/c1-5-7(9)3-6(11-2)4-8(5)10/h3-4H,1-2H3 |
| InChI Key | BZRKRRXRNGVEIZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-DI-TERT-BUTYLANILINE | 2380-36-1 | 2A-1125295 |
| 3,5-DIAMINO-2,6-DIMETHYLBENZOIC ACID | 219297-24-2 | 2A-0125300 |
| 3,5-DIBROMO-1,1'-BIPHENYL | 16372-96-6 | 2A-0125307 |
| 3,5-DIBROMO-1-METHYLPYRAZIN-2(1H)-ONE | 87486-34-8 | 2A-0125310 |
| 3,5-DIBROMO-4-FLUOROANILINE | 1003709-35-0 | 2A-0125338 |
| 3,5-DIBROMO-6-CHLOROPYRIDIN-2-OL | 6515-39-5 | 2A-0125355 |
| 3,5-DIBROMOANILINE HYDROCHLORIDE | 188349-40-8 | 2A-0125359 |
| 3,5-DIBROMOBENZENE-1,2-DIAMINE | 1575-38-8 | 2A-0125362 |
| 3,5-DIBROMOISONICOTINONITRILE | 870244-34-1 | 2A-0125371 |
| 3,5-DICHLORO-2,4,6-TRIFLUOROBENZOIC ACID | 13656-36-5 | 2A-0125383 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA