
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 219297-24-2 |
| Catalog No. | 2A-0125300 |
| Chinese Name | 3,5-二氨基-2,6-二甲基苯甲酸 |
| Synonyms | Benzoic acid,3,5-diamino-2,6-dimethyl |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.341 |
| Purity | 96+ |
| Density | 1.295g/cm3 |
| Boiling Point | 425.3ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2922499990 |
| UN(IATA) | 0 |
| PubChem ID | 6458167 |
| MDL Number | MFCD01661196 |
| SMILES | Cc1c(N)cc(N)c(C)c1C(=O)O |
| InChI | InChI=1S/C9H12N2O2/c1-4-6(10)3-7(11)5(2)8(4)9(12)13/h3H,10-11H2,1-2H3,(H,12,13) |
| InChI Key | BIKOQOQJOSLXSQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | P. Quarantine of entry animals, plants, and animal and plant products Q. Quarantine of exit animals, plants, and animal and plant products R. Hygiene supervision and inspection of imported food S. Hyg |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5,6-TRIBROMOPYRIDIN-2-AMINE | 63875-38-7 | 2A-0125251 |
| 3,5,7-TRIHYDROXY-2-(3,4,5-TRIMETHOXYPHENYL)-4H-CHROMEN-4-ONE | 146132-95-8 | 2A-0125255 |
| 3,5-BIS(METHYLSULFONYL)BENZONITRILE | 169696-83-7 | 2A-0125267 |
| 3,5-BIS(METHYLSULPHONYL)BENZOIC ACID | 90536-91-7 | 2A-0125268 |
| 3,5-DI-TERT-BUTYLANILINE | 2380-36-1 | 2A-1125295 |
| 3,5-DIBROMO-1,1'-BIPHENYL | 16372-96-6 | 2A-0125307 |
| 3,5-DIBROMO-1-METHYLPYRAZIN-2(1H)-ONE | 87486-34-8 | 2A-0125310 |
| 3,5-DIBROMO-4-FLUOROANILINE | 1003709-35-0 | 2A-0125338 |
| 3,5-DIBROMO-4-METHYLANISOLE | 14542-71-3 | 2A-0125347 |
| 3,5-DIBROMO-6-CHLOROPYRIDIN-2-OL | 6515-39-5 | 2A-0125355 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA