
CAS Number51110-01-1
Synonymsgrowth hormone inhibiting hormone; 15-28-Somatostatin-28; Modustatina; SS-14; EINECS 254-186-5; Somatostatin Acetate; Somatofalk; Stilamin; GH-RIF; SRIF-A; somatotropin release inhibiting factor; SRIF; Somatostatin; Somatostatina; Aminopan
Molecular FormulaC76H104N18O19S2
Molecular Weight1637.878
Purity97%
Density1.4±0.1 g/cm3
Boiling Point1970.9±65.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51110-01-1 |
| Catalog No. | 2A-9012482 |
| Chinese Name | 生长抑素 |
| Synonyms | growth hormone inhibiting hormone; 15-28-Somatostatin-28; Modustatina; SS-14; EINECS 254-186-5; Somatostatin Acetate; Somatofalk; Stilamin; GH-RIF; SRIF-A; somatotropin release inhibiting factor; SRIF; Somatostatin; Somatostatina; Aminopan |
| Molecular Formula | C76H104N18O19S2 |
| Molecular Weight | 1637.878 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1970.9±65.0 °C at 760 mmHg |
| Appearance | powder |
| Water Solubility | H2O: 1 mg/mL |
| Storage Condition | Sealed in a cool, dry environment at -20 ºC |
| Application | Somatostatin is a tetradecapeptide that inhibits the secretion of growth hormone (GH) and can also control the secretion of pituitary hormones in the human central nervous system. |
| MDL Number | MFCD00076762 |
| SMILES | CC(N)C(=O)NCC(=O)NC1CSSCC(C(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(Cc2ccccc2)NC(=O)C(C(C)O)NC(=O)C(CCCCN)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(N)=O)NC(=O)C(CCCCN)NC1=O |
| InChI | InChI=1S/C76H104N18O19S2/c1-41(79)64(100)82-37-61(99)83-58-39-114-115-40-59(76(112)113)92-72(108)57(38-95)91-75(111)63(43(3)97)94-71(107)54(33-46-23-11-6-12-24-46)90-74(110)62(42(2)96)93-66(102)51(28-16-18-30-78)84-69(105)55(34-47-36-81-49-26-14-13-25-48(47)49)88-68(104)53(32-45-21-9-5-10-22-45)86-67(103)52(31-44-19-7-4-8-20-44)87-70(106)56(35-60(80)98)89-65(101)50(85-73(58)109)27-15-17-29-77/h4-14,19-26,36,41-43,50-59,62-63,81,95-97H,15-18,27-35,37-40,77-79H2,1-3H3,(H2,80,98)(H,82,100)(H,83,99)(H,84,105)(H,85,109)(H,86,103)(H,87,106)(H,88,104)(H,89,101)(H,90,110)(H,91,111)(H,92,108)(H,93,102)(H,94,107)(H,112,113) |
| InChI Key | NHXLMOGPVYXJNR-UHFFFAOYSA-N |
| NACRES Code | NA.51 |
| UNSPSC | 51111800 |
| MSDS | msds/12482_1_51110_01_1.pdf |
| Transport Info | Product Name: Somatostatin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Solanesol | 13190-97-1 | 2A-9012477 |
| Solanidine | 80-78-4 | 2A-9012478 |
| Solasodine | 126-17-0 | 2A-9012479 |
| Solpecainol | 68567-30-6 | 2A-9012480 |
| Solypertine | 4448-96-8 | 2A-9012481 |
| Sophocarpine | 145572-44-7 | 2A-9012483 |
| Sophoricoside | 152-95-4 | 2A-9012484 |
| Soquinolol | 61563-18-6 | 2A-9012485 |
| Sorbinicate | 6184-06-1 | 2A-9012486 |
| Sorbinil | 68367-52-2 | 2A-9012487 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA