
CAS Number126-17-0
Synonyms(3b,22a,25R)-Spirosol-5-en-3-ol; Solanearpidine; Solasod-5-en-3β-ol; (3β,22α,25R)-Spirosol-5-en-3-ol; Solancarpidine; Solasod-5-en-3b-ol; Purapuridine; MFCD00037844; EINECS 204-774-2; Solasod-5-en-3-β-ol; Solanidine-S; Solasodine; D5-20bF,22aF,25aF,28-azaspirosten-3b-ol
Molecular FormulaC27H43NO2
Molecular Weight413.64
Purity≥98.0 (HPLC)%
Density1.1±0.1 g/cm3
Boiling Point537.9±50.0 °C at 760 mmHg
Melting Point284 °C (dec.)(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 126-17-0 |
| Catalog No. | 2A-9012479 |
| Chinese Name | 澳洲茄胺; 澳州茄胺 |
| Synonyms | (3b,22a,25R)-Spirosol-5-en-3-ol; Solanearpidine; Solasod-5-en-3β-ol; (3β,22α,25R)-Spirosol-5-en-3-ol; Solancarpidine; Solasod-5-en-3b-ol; Purapuridine; MFCD00037844; EINECS 204-774-2; Solasod-5-en-3-β-ol; Solanidine-S; Solasodine; D5-20bF,22aF,25aF,28-azaspirosten-3b-ol |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.64 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 537.9±50.0 °C at 760 mmHg |
| Melting Point | 284 °C (dec.)(lit.) |
| Water Solubility | 200 g/L (25 ºC) |
| Storage Condition | 2-8°C |
| Application | Solasodine (Purapuridine) is a toxic alkaloid found in Solanaceae plants and is selectively cytotoxic to cervical cancer cell lines (HeLa) and human myeloid leukemia cell lines (U937). |
| SMILES | C[C@@H]1[C@]2(NC[C@H](C)CC2)O[C@@]3([H])C[C@@]4([H])[C@]5([H])CC=C6C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC[C@]4(C)[C@]31[H] |
| InChI | 1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChI Key | KWVISVAMQJWJSZ-VKROHFNGSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/12479_1_126_17_0.pdf |
| Transport Info | Product name: Australian solanamine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium Tyropanoate | 7246-21-1 | 2A-9012473 |
| Sodiumoleate | 143-19-1 | 2A-9012474 |
| Sofalcone | 64506-49-6 | 2A-9012476 |
| Solanesol | 13190-97-1 | 2A-9012477 |
| Solanidine | 80-78-4 | 2A-9012478 |
| Solpecainol | 68567-30-6 | 2A-9012480 |
| Solypertine | 4448-96-8 | 2A-9012481 |
| Somatostatin | 51110-01-1 | 2A-9012482 |
| Sophocarpine | 145572-44-7 | 2A-9012483 |
| Sophoricoside | 152-95-4 | 2A-9012484 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA