![3,3',5,5'-TETRA-TERT-BUTYL-[1,1'-BIPHENYL]-4,4'-DIOL structure, CAS 128-38-1](/structures/150000/124800_1_128_38_1.png)
CAS Number128-38-1
Synonyms2,2',6,6'-tetra-tert-butyl-p,p'-biphenol; EINECS 204-883-5; 3,3',5,5'-Tetra-tert-butylbiphenyl-4,4'-diol; 3,3',5,5'-tetra-t-butyl-4,4'-dihydroxybiphenyl; 2,2',6,6'-tetra-tert-butyl-4,4'-biphenol; Ethyl 712; 4,3,3',5,5'-tetra-tert-butyl
Molecular FormulaC28H42O2
Molecular Weight410.646
Purity96+%
Density0.981g/cm3
Boiling Point460.4ºC at 760 mmHg
Melting Point185ºC
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 128-38-1 |
| Catalog No. | 2A-0124800 |
| Chinese Name | 四叔丁基联苯酚 |
| Synonyms | 2,2',6,6'-tetra-tert-butyl-p,p'-biphenol; EINECS 204-883-5; 3,3',5,5'-Tetra-tert-butylbiphenyl-4,4'-diol; 3,3',5,5'-tetra-t-butyl-4,4'-dihydroxybiphenyl; 2,2',6,6'-tetra-tert-butyl-4,4'-biphenol; Ethyl 712; 4,3,3',5,5'-tetra-tert-butyl |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.646 |
| Purity | 96+ |
| Density | 0.981g/cm3 |
| Boiling Point | 460.4ºC at 760 mmHg |
| Melting Point | 185ºC |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2907299090 |
| UN(IATA) | 0 |
| PubChem ID | 78657 |
| MDL Number | MFCD00069443 |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H42O2/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3 |
| InChI Key | GSOYMOAPJZYXTB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3'-NITRO-[1,1'-BIPHENYL]-3-OL | 136539-67-8 | 2A-0124784 |
| 3'-NITRO-[1,1'-BIPHENYL]-4-CARBONITRILE | 39117-72-1 | 2A-0124785 |
| 3'-NITRO-[1,1'-BIPHENYL]-4-OL | 53059-30-6 | 2A-0124786 |
| 3,10-DIMETHYLQUINOLINO[2,3-B]ACRIDINE-7,14(5H,12H)-DIONE | 16043-40-6 | 2A-0124790 |
| 3,3'',5,5''-TETRABROMO-5'-(3,5-DIBROMOPHENYL)-1,1':3',1''-TERPHENYL | 29102-67-8 | 2A-0124792 |
| 3,3',5,5'-TETRABROMO-1,1'-BIPHENYL | 16400-50-3 | 2A-0124801 |
| 3,3',5,5'-TETRAISOPROPYLBIPHENYL-4,4'-DIOL | 2416-95-7 | 2A-0124803 |
| 3,3'-(BENZYLAZANEDIYL)DIPROPANENITRILE | 16728-92-0 | 2A-0124807 |
| 3,3'-BIPYRIDIN]-6-AMINE | 31970-30-6 | 2A-0124810 |
| 3,3'-DIBROMO-1,1'-BIPHENYL | 16400-51-4 | 2A-1124817 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA