
CAS Number29102-67-8
Synonyms1,1':3',1''-Terphenyl,3,3'',5,5''-tetrabromo-5-(3,5-dibromophenyl); 1,3,5-tri(3,5-dibromophenyl)benzene; 3',5',3',5',3'',5''-Hexabromo-triphenylbenzol; 3,3'',5,5''-Tetrabromo-5'-(3,5-dibromophenyl)-1,1':3',1''-terphenyl; 1,3,5-tris(3',5'-dibromophenyl)benzene; 1,3,5-Tris(3,5-dibromophenyl)benzene
Molecular FormulaC24H12Br6
Molecular Weight779.78
Purity96+%
Density2.039 g/cm3
Boiling Point623.1ºC at 760 mmHg
Melting Point315 °C
AppearanceSolid;Light yellow to Brown to Dark green powder to crystal
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29102-67-8 |
| Catalog No. | 2A-0124792 |
| Chinese Name | 1,3,5-三(3,5-二溴苯基)苯 |
| Synonyms | 1,1':3',1''-Terphenyl,3,3'',5,5''-tetrabromo-5-(3,5-dibromophenyl); 1,3,5-tri(3,5-dibromophenyl)benzene; 3',5',3',5',3'',5''-Hexabromo-triphenylbenzol; 3,3'',5,5''-Tetrabromo-5'-(3,5-dibromophenyl)-1,1':3',1''-terphenyl; 1,3,5-tris(3',5'-dibromophenyl)benzene; 1,3,5-Tris(3,5-dibromophenyl)benzene |
| Molecular Formula | C24H12Br6 |
| Molecular Weight | 779.78 |
| Purity | 96+ |
| Density | 2.039 g/cm3 |
| Boiling Point | 623.1ºC at 760 mmHg |
| Melting Point | 315 °C |
| Appearance | Solid;Light yellow to Brown to Dark green powder to crystal |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 0 |
| UN(IATA) | 0 |
| PubChem ID | 8690554 |
| SMILES | Brc1cc(Br)cc(-c2cc(-c3cc(Br)cc(Br)c3)cc(-c3cc(Br)cc(Br)c3)c2)c1 |
| InChI | InChI=1S/C24H12Br6/c25-19-4-16(5-20(26)10-19)13-1-14(17-6-21(27)11-22(28)7-17)3-15(2-13)18-8-23(29)12-24(30)9-18/h1-12H |
| InChI Key | VBMGLVNBADCRDN-UHFFFAOYSA-N |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3'-NITRO-[1,1'-BIPHENYL]-3-CARBONITRILE | 192699-67-5 | 2A-0124783 |
| 3'-NITRO-[1,1'-BIPHENYL]-3-OL | 136539-67-8 | 2A-0124784 |
| 3'-NITRO-[1,1'-BIPHENYL]-4-CARBONITRILE | 39117-72-1 | 2A-0124785 |
| 3'-NITRO-[1,1'-BIPHENYL]-4-OL | 53059-30-6 | 2A-0124786 |
| 3,10-DIMETHYLQUINOLINO[2,3-B]ACRIDINE-7,14(5H,12H)-DIONE | 16043-40-6 | 2A-0124790 |
| 3,3',5,5'-TETRA-TERT-BUTYL-[1,1'-BIPHENYL]-4,4'-DIOL | 128-38-1 | 2A-0124800 |
| 3,3',5,5'-TETRABROMO-1,1'-BIPHENYL | 16400-50-3 | 2A-0124801 |
| 3,3',5,5'-TETRAISOPROPYLBIPHENYL-4,4'-DIOL | 2416-95-7 | 2A-0124803 |
| 3,3'-(BENZYLAZANEDIYL)DIPROPANENITRILE | 16728-92-0 | 2A-0124807 |
| 3,3'-BIPYRIDIN]-6-AMINE | 31970-30-6 | 2A-0124810 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA