
CAS Number117-22-6
Synonyms8-hydroxynaphthalenesulfonic acid; 1-Naphthalenesulfonic acid,8-hydroxy; 1-NAPHTHOL-8-SULFOMIC ACID; 1-NAPHTHOL-8-SULFONIC ACID; 1-Hydroxynaphthalin-8-sulfonsaeure; EINECS 204-180-3; 1 NAPTHOL-8-SULPHONIC ACID; 8-Hydroxy-naphthalin-1-sulfonsaeure; 8-hydroxy-naphthalene-1-sulfonic acid; 8-hydroxynaphthalenesulphonic acid; 8-hydroxy-1-naphthalenesulfonic acid; 1-Hydroxy-naphthalinsulfonsaeure-8; MFCD00065328
Molecular FormulaC10H8O4S1
Molecular Weight224.24
Purity98%
Density1.549
AppearanceGray to brown powder
EINECS204-180-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 117-22-6 |
| Catalog No. | 2A-9001247 |
| Chinese Name | 8-羟基萘-1-磺酸 |
| Synonyms | 8-hydroxynaphthalenesulfonic acid; 1-Naphthalenesulfonic acid,8-hydroxy; 1-NAPHTHOL-8-SULFOMIC ACID; 1-NAPHTHOL-8-SULFONIC ACID; 1-Hydroxynaphthalin-8-sulfonsaeure; EINECS 204-180-3; 1 NAPTHOL-8-SULPHONIC ACID; 8-Hydroxy-naphthalin-1-sulfonsaeure; 8-hydroxy-naphthalene-1-sulfonic acid; 8-hydroxynaphthalenesulphonic acid; 8-hydroxy-1-naphthalenesulfonic acid; 1-Hydroxy-naphthalinsulfonsaeure-8; MFCD00065328 |
| Molecular Formula | C10H8O4S1 |
| Molecular Weight | 224.24 |
| Purity | 98 |
| Density | 1.549 |
| Appearance | Gray to brown powder |
| Storage Condition | Room Temperature |
| EINECS | 204-180-3 |
| HTC | 2908999090 |
| MDL Number | MFCD00065328 |
| SMILES | O=S(=O)(O)c1cccc2cccc(O)c12 |
| InChI | InChI=1S/C10H8O4S/c11-8-5-1-3-7-4-2-6-9(10(7)8)15(12,13)14/h1-6,11H,(H,12,13,14) |
| InChI Key | ZPLBZGGKAUXTRT-UHFFFAOYSA-N |
| MSDS | msds/1247_1_117_22_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product Name: Summary 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methylhistidine | 368-16-1 | 2A-9001232 |
| 1-Methylthio-2-butanone | 13678-58-5 | 2A-9001237 |
| 1-Naphthalene acetic acid | 86-87-3 | 2A-9001240 |
| 1-Naphthalimide | 2243-81-4 | 2A-9001244 |
| 1-Naphthol-4-sulfonic acid | 84-87-7 | 2A-9001246 |
| 1-Naphthoyl chloride | 879-18-5 | 2A-9001248 |
| 1-Naphthylhydrazine hydrochloride | 2243-56-3 | 2A-9001250 |
| 1-Nitroso-2-naphthol | 131-91-9 | 2A-9001265 |
| 1-Octanesulfonic acid sodium salt | 5324-84-5 | 2A-9001268 |
| 1-Octen-3-one | 4312-99-6 | 2A-9001269 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA