CAS Number84-87-7
SynonymsEINECS 201-568-4; 4-Hydroxy-1-naphthalenesulfonic acid; 1-hydroxy-naphthalene-4-sulphonic acid; 1-naphthol-4-sulphonic acid; Neville and winther acid; 4-sulfonaphthol; 1-Naphthol-4-sulfoni; 1,4-Oxy Acid; 1-Naphthol-4-sulfonic acid; Nevile-Winthers acid; 1-hydroxy-4-naphthalenesulfonic acid; naphthalene 1-hydroxy-4-sulfonic acid; Neville acid; a-Naphthol-4-sulfonic acid; MFCD00065324; 4-Hydroxynaphthalene-1-sulfonic acid; Nevile-Winther acid; 1-oxynaphthalene-4-sulphonic acid
Molecular FormulaC10H8O4S
Molecular Weight250.23
Purity97%
Density1.5±0.1 g/cm3
Boiling Point427ºC
Melting Point160 °C (dec.) (lit.)
Appearancepowder
EINECS212-958-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84-87-7 |
| Catalog No. | 2A-9001246 |
| Chinese Name | 1-萘酚-4-磺酸 |
| Synonyms | EINECS 201-568-4; 4-Hydroxy-1-naphthalenesulfonic acid; 1-hydroxy-naphthalene-4-sulphonic acid; 1-naphthol-4-sulphonic acid; Neville and winther acid; 4-sulfonaphthol; 1-Naphthol-4-sulfoni; 1,4-Oxy Acid; 1-Naphthol-4-sulfonic acid; Nevile-Winthers acid; 1-hydroxy-4-naphthalenesulfonic acid; naphthalene 1-hydroxy-4-sulfonic acid; Neville acid; a-Naphthol-4-sulfonic acid; MFCD00065324; 4-Hydroxynaphthalene-1-sulfonic acid; Nevile-Winther acid; 1-oxynaphthalene-4-sulphonic acid |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 250.23 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 427ºC |
| Melting Point | 160 °C (dec.) (lit.) |
| Appearance | powder |
| Storage Condition | Strong acids, strong alkali and toxic raw material |
| Packaging | II |
| EINECS | 212-958-9 |
| HTC | 2908999090 |
| PubChem ID | 24853621 |
| MDL Number | MFCD00012409 |
| SMILES | Oc1cc(c2ccccc2c1[N+]#N)S([O-])(=O)=O |
| InChI | 1S/C10H6N2O4S/c11-12-10-7-4-2-1-3-6(7)9(5-8(10)13)17(14,15)16/h1-5H,(H-,13,14,15,16) |
| InChI Key | QHIBNGIZPPHJAT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/1246_1_84_87_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product Name: Summary 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methylhexahydroazepin-4-one hydrochloride | 19869-42-2 | 2A-9001231 |
| 1-Methylhistidine | 368-16-1 | 2A-9001232 |
| 1-Methylthio-2-butanone | 13678-58-5 | 2A-9001237 |
| 1-Naphthalene acetic acid | 86-87-3 | 2A-9001240 |
| 1-Naphthalimide | 2243-81-4 | 2A-9001244 |
| 1-Naphthol-8-sulfonic acid | 117-22-6 | 2A-9001247 |
| 1-Naphthoyl chloride | 879-18-5 | 2A-9001248 |
| 1-Naphthylhydrazine hydrochloride | 2243-56-3 | 2A-9001250 |
| 1-Nitroso-2-naphthol | 131-91-9 | 2A-9001265 |
| 1-Octanesulfonic acid sodium salt | 5324-84-5 | 2A-9001268 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS