
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115-53-7 |
| Catalog No. | 2A-9012456 |
| Chinese Name | 青藤碱 |
| Synonyms | EINECS 204-094-6; MFCD00134303 |
| Molecular Formula | C19H23O4N1 |
| Molecular Weight | 329.4 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 513.6±50.0 °C at 760 mmHg |
| Melting Point | 180ºC |
| Appearance | white powder |
| Storage Condition | Store airtight in a cool and dry place. |
| Packaging | III |
| Application | Sinomenine is an alkaloid from Sinomenium acutum and is a blocker of NF-κB activation. Sinomenine is also a μ-opioid receptor activator. |
| MDL Number | MFCD00134303 |
| SMILES | COC1=CC2C3Cc4ccc(OC)c(O)c4C2(CCN3C)CC1=O |
| InChI | InChI=1S/C19H23NO4.ClH/c1-20-7-6-19-10-14(21)16(24-3)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19;/h4-5,9,12-13,22H,6-8,10H2,1-3H3;1H/t12-,13+,19-;/m1./s1 |
| InChI Key | INYYVPJSBIVGPH-QHRIQVFBSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/12456_1_115_53_7.pdf |
| Transport Info | Product Name: Sinomenine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Simfibrate | 14929-11-4 | 2A-9012450 |
| Simmondsin | 51771-52-9 | 2A-9012451 |
| Sincalide | 25126-32-3 | 2A-9012453 |
| Sinefungin | 58944-73-3 | 2A-9012454 |
| Sinitrodil | 143248-63-9 | 2A-9012455 |
| Sinomenine hydrochloride | 6080-33-7 | 2A-9012457 |
| Siratiazem | 138778-28-6 | 2A-9012458 |
| Sisomicin sulfate | 53776-71-9 | 2A-9012459 |
| Sitofibrate | 55902-94-8 | 2A-9012460 |
| Sivelestat sodium | 201677-61-4 | 2A-9012461 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA