CAS Number81-27-6
SynonymsTomato juice; SennosideA; PURSENNID; Sennoside A; Sennoside B; EINECS 201-339-9; MFCD00151527; Glysennid; GLYSENNIDE; SENNOSIDA; PURSENNIDE; SENNOSIDE
Molecular FormulaC42H38O20
Molecular Weight862.74
Purity≥96.0 (HPLC)%
Density1.7±0.1 g/cm3
Boiling Point1144.8±65.0 °C at 760 mmHg
Melting Point200-240ºC
EINECS201-339-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81-27-6 |
| Catalog No. | 2A-9012420 |
| Chinese Name | 番泻苷A |
| Synonyms | Tomato juice; SennosideA; PURSENNID; Sennoside A; Sennoside B; EINECS 201-339-9; MFCD00151527; Glysennid; GLYSENNIDE; SENNOSIDA; PURSENNIDE; SENNOSIDE |
| Molecular Formula | C42H38O20 |
| Molecular Weight | 862.74 |
| Purity | ≥96.0 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1144.8±65.0 °C at 760 mmHg |
| Melting Point | 200-240ºC |
| Storage Condition | This product should be sealed and stored in a dry |
| Application | Sennoside A is an anthraquinone glycoside found in abundance in the leaves and pods of Cassia angustifolia. Sennoside A is an HIV-1 inhibitor that inhibits HIV-1 replication. |
| EINECS | 201-339-9 |
| PubChem ID | 329761216 |
| MDL Number | MFCD00151527 |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3[C@@H]([C@@H]4c5cccc(O[C@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c5C(=O)c7c(O)cc(cc47)C(O)=O)c8cc(cc(O)c8C(=O)c23)C(O)=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | 1S/C42H38O20/c43-11-23-31(47)35(51)37(53)41(61-23)59-21-5-1-3-15-25(17-7-13(39(55)56)9-19(45)27(17)33(49)29(15)21)26-16-4-2-6-22(60-42-38(54)36(52)32(48)24(12-44)62-42)30(16)34(50)28-18(26)8-14(40(57)58)10-20(28)46/h1-10,23-26,31-32,35-38,41-48,51-54H,11-12H2,(H,55,56)(H,57,58)/t23-,24-,25-,26-,31-,32-,35+,36+,37-,38-,41-,42?/m1/s1 |
| InChI Key | IPQVTOJGNYVQEO-GTCVFCFLSA-N |
| Beilstein/REAXYS | 5723746 |
| NACRES Code | NA.24 |
| UNSPSC | 85151701 |
| MSDS | msds/12420_1_81_27_6.pdf |
| Transport Info | Product Name: Sennoside A |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Salvianolic acid B | 115939-25-8 | 2A-9012382 |
| Schisandrin | 7432-28-2 | 2A-9012402 |
| Schisandrol B | 58546-54-6 | 2A-9012403 |
| Securinine | 5610-40-2 | 2A-9012411 |
| Sennidine A | 641-12-3 | 2A-9012419 |
| Sennoside B | 128-57-4 | 2A-9012421 |
| Silybin | 22888-70-6 | 2A-9012445 |
| Silychristin | 33889-69-9 | 2A-9012446 |
| Triammonium glycyrrhizinate | 2A-303896 | 2A-9012812 |
| Ursolic acid | 77-52-1 | 2A-9012894 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS