
CAS Number125926-17-2
SynonymsUNII-19P708E787; Sarpogrelate Hydrochloride; Butanedioic acid, mono[2-(dimethylamino)-1-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]ethyl] ester; 4-{[1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanyl]oxy}-4-oxobutanoic acid; Sarpogrelate
Molecular FormulaC24H31NO6
Molecular Weight465.97
Purity98%
Density1.2±0.1 g/cm3
Boiling Point585.9±50.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 125926-17-2 |
| Catalog No. | 2A-9012396 |
| Chinese Name | 沙格雷酯 |
| Synonyms | UNII-19P708E787; Sarpogrelate Hydrochloride; Butanedioic acid, mono[2-(dimethylamino)-1-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]ethyl] ester; 4-{[1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanyl]oxy}-4-oxobutanoic acid; Sarpogrelate |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 465.97 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 585.9±50.0 °C at 760 mmHg |
| Application | Sapogliflozide (MCI-9042) is a new, specific, orally active 5-HT2 receptor antagonist, which can increase platelet aggregation and has a hemostatic effect, and can be used to study Buerger's disease [ |
| MDL Number | C24H32ClNO6 |
| SMILES | COc1cccc(CCc2ccccc2OCC(CN(C)C)OC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C24H31NO6/c1-25(2)16-21(31-24(28)14-13-23(26)27)17-30-22-10-5-4-8-19(22)12-11-18-7-6-9-20(15-18)29-3/h4-10,15,21H,11-14,16-17H2,1-3H3,(H,26,27) |
| InChI Key | FFYNAVGJSYHHFO-UHFFFAOYSA-N |
| MSDS | msds/12396_1_125926_17_2.pdf |
| Transport Info | Product name: Sargrexate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Saperconazole | 110588-57-3 | 2A-9012389 |
| Saprisartan | 146623-69-0 | 2A-9012390 |
| Sarafloxacin | 98105-99-8 | 2A-9012393 |
| Sarafloxacin hydrochloride | 91296-87-6 | 2A-9012394 |
| Sarcosinamide hydrochloride | 5325-64-4 | 2A-9012395 |
| Sarpogrelate hydrochloride | 135159-51-2 | 2A-9012397 |
| Saterinone | 102669-89-6 | 2A-9012398 |
| Satigrel | 111753-73-2 | 2A-9012399 |
| Satraplatin | 129580-63-8 | 2A-9012400 |
| Satumomab | 144058-40-2 | 2A-9012401 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA