
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14224-99-8 |
| Catalog No. | 2A-0123676 |
| Chinese Name | 2-甲基-4,5-二苯基恶唑 |
| Synonyms | 2-methyl-4,5-diphenyl-1,3-oxazole |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.352 |
| Purity | 96+ |
| Density | 1.108g/cm3 |
| Boiling Point | 214ºC17 mm Hg(lit.) |
| Melting Point | 28ºC(lit.) |
| Appearance | Liquid;Light yellow to Yellow to Orange clear liquid |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2934999090 |
| UN(IATA) | 0 |
| PubChem ID | 3138833 |
| MDL Number | MFCD00186180 |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H13NO/c1-12-17-15(13-8-4-2-5-9-13)16(18-12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChI Key | QLQIWRCWPJRJJA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-METHYL-2H-INDAZOLE | 4838-00-0 | 2A-0123613 |
| 2-METHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE | 20348-19-0 | 2A-0123616 |
| 2-METHYL-3-(PIPERIDIN-4-YL)-1H-INDOLE | 65347-61-7 | 2A-0123638 |
| 2-METHYL-3-NITROQUINOLINE | 75353-77-4 | 2A-0123661 |
| 2-METHYL-3-PROPYLPYRAZINE | 15986-80-8 | 2A-0123664 |
| 2-METHYL-4-((TETRAHYDROFURAN-2-YL)METHOXY)ANILINE | 926259-32-7 | 2A-0123680 |
| 2-METHYL-4-(P-TOLYL)THIAZOLE | 66047-73-2 | 2A-0123701 |
| 2-METHYL-4-(PIPERAZIN-1-YL)-6-(TRIFLUOROMETHYL)PYRIMIDINE | 893752-50-6 | 2A-0123702 |
| 2-METHYL-4-(PIPERAZIN-1-YL)PYRIMIDINE | 131816-67-6 | 2A-0123703 |
| 2-METHYL-4-(PIPERIDIN-1-YLMETHYL)THIAZOLE | 17386-15-1 | 2A-0123705 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA