
CAS Number15986-80-8
Synonyms2-Methyl-3-n-propylpyrazine; EINECS 240-121-8; 3-Propyl-2-methylpyrazine; 2-Methyl-3-propylpyrazine; MFCD00010096
Molecular FormulaC8H12N2
Molecular Weight229.62
Purity96+%
Density1.0±0.1 g/cm3
Boiling Point189.3±0.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Light orange to Yellow clear liquid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15986-80-8 |
| Catalog No. | 2A-0123664 |
| Chinese Name | 2-甲基-3-丙基吡嗪 |
| Synonyms | 2-Methyl-3-n-propylpyrazine; EINECS 240-121-8; 3-Propyl-2-methylpyrazine; 2-Methyl-3-propylpyrazine; MFCD00010096 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 229.62 |
| Purity | 96+ |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 189.3±0.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Light orange to Yellow clear liquid |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2933990090 |
| UN(IATA) | 0 |
| PubChem ID | 3153799 |
| SMILES | CCCc1nccnc1C |
| InChI | InChI=1S/C8H12N2/c1-3-4-8-7(2)9-5-6-10-8/h5-6H,3-4H2,1-2H3 |
| InChI Key | XAWKNALRUSOTOY-UHFFFAOYSA-N |
| UNSPSC | 41116107 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-METHYL-2H-BENZO[D][1,2,3]TRIAZOLE | 16584-00-2 | 2A-0123609 |
| 2-METHYL-2H-INDAZOLE | 4838-00-0 | 2A-0123613 |
| 2-METHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE | 20348-19-0 | 2A-0123616 |
| 2-METHYL-3-(PIPERIDIN-4-YL)-1H-INDOLE | 65347-61-7 | 2A-0123638 |
| 2-METHYL-3-NITROQUINOLINE | 75353-77-4 | 2A-0123661 |
| 2-METHYL-4,5-DIPHENYLOXAZOLE | 14224-99-8 | 2A-0123676 |
| 2-METHYL-4-((TETRAHYDROFURAN-2-YL)METHOXY)ANILINE | 926259-32-7 | 2A-0123680 |
| 2-METHYL-4-(P-TOLYL)THIAZOLE | 66047-73-2 | 2A-0123701 |
| 2-METHYL-4-(PIPERAZIN-1-YL)-6-(TRIFLUOROMETHYL)PYRIMIDINE | 893752-50-6 | 2A-0123702 |
| 2-METHYL-4-(PIPERAZIN-1-YL)PYRIMIDINE | 131816-67-6 | 2A-0123703 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA