
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 139755-99-0 |
| Catalog No. | 2A-9001221 |
| Chinese Name | 1-甲基-3-丙基-1H-吡唑-5-羧酸 |
| Synonyms | 2-methyl-5-propylpyrazole-3-carboxylic acid; MFCD02169703 |
| Molecular Formula | C8H12O2N2 |
| Molecular Weight | 168.2 |
| Purity | 98 |
| Density | 1.19g/cm3 |
| Boiling Point | 330.3ºC at 760mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| MDL Number | MFCD02169703 |
| SMILES | CCCc1cc(C(=O)O)n(C)n1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-4-6-5-7(8(11)12)10(2)9-6/h5H,3-4H2,1-2H3,(H,11,12)/p-1 |
| InChI Key | KOABFSONXOOIIH-UHFFFAOYSA-N |
| MSDS | msds/1221_1_139755_99_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Methyl-1H-indazole-3-carboxy chloride | 106649-02-9 | 2A-9001216 |
| 1-Methyl-2,4(1H,3H)-pyrimidinedione | 615-77-0 | 2A-9001217 |
| 1-Methyl-2-phenylindole | 3558-24-5 | 2A-9001218 |
| 1-Methyl-2-phenylindole-3-carboxyaldehyde | 1757-72-8 | 2A-9001219 |
| 1-Methyl-3-indolecarboxylic acid | 32387-21-6 | 2A-9001220 |
| 1-Methyl-4-nitro-3-propylpyrazole-5-carboxamide | 2A-101223 | 2A-9001223 |
| 1-Methyl-5-aminopyrazole | 1192-21-8 | 2A-9001225 |
| 1-Methyl-5-chloroimidazole | 872-49-1 | 2A-9001226 |
| 1-Methyl-5-mercaptotetrazole | 13183-79-4 | 2A-9001227 |
| 1-Methyladenine | 5142-22-3 | 2A-9001228 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA