
CAS Number22224-92-6
SynonymsFenamiphos PESTANAL(R),analytical standard; Caswell No. 453A; Nemacur P; Ethyl 3-methyl-4-(methylsulfanyl)phenyl isopropylphosphoramidate; (RS)-(ethyl 4-methylthio-m-tolyl isopropylphosphoramidate); N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine; 1Y1&MPO&O2&OR C1 DS1; (Ξ)-[ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate]; MFCD00055454; Phosphoramidic acid, N-(1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester; fenamiphos; Nemacur; ethyl 3-methyl-4-(methylthio)phenyl (1-methylethyl)phosphoramidate; Methaphenamiphos; Ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate; Phenamiphos; EINECS 244-848-1
Molecular FormulaC13H22NO3PS
Molecular Weight303.36
Purity98%
Density1.1±0.1 g/cm3
Boiling Point375.6±52.0 °C at 760 mmHg
Melting Point49°C
AppearanceBrown waxy solid or colorless solid
EINECS244-848-1
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22224-92-6 |
| Catalog No. | 2A-9011955 |
| Chinese Name | 苯线磷 |
| Synonyms | Fenamiphos PESTANAL(R),analytical standard; Caswell No. 453A; Nemacur P; Ethyl 3-methyl-4-(methylsulfanyl)phenyl isopropylphosphoramidate; (RS)-(ethyl 4-methylthio-m-tolyl isopropylphosphoramidate); N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine; 1Y1&MPO&O2&OR C1 DS1; (Ξ)-[ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate]; MFCD00055454; Phosphoramidic acid, N-(1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester; fenamiphos; Nemacur; ethyl 3-methyl-4-(methylthio)phenyl (1-methylethyl)phosphoramidate; Methaphenamiphos; Ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate; Phenamiphos; EINECS 244-848-1 |
| Molecular Formula | C13H22NO3PS |
| Molecular Weight | 303.36 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 375.6±52.0 °C at 760 mmHg |
| Melting Point | 49°C |
| Appearance | Brown waxy solid or colorless solid |
| Water Solubility | 0.07 g/100 mL |
| Storage Condition | 0-6℃ |
| Packaging | I |
| EINECS | 244-848-1 |
| HTC | 2930909064 |
| PubChem ID | 329756775 |
| MDL Number | MFCD00055454 |
| SMILES | CCOP(=O)(NC(C)C)Oc1ccc(SC)c(C)c1 |
| InChI | 1S/C13H22NO3PS/c1-6-16-18(15,14-10(2)3)17-12-7-8-13(19-5)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15) |
| InChI Key | ZCJPOPBZHLUFHF-UHFFFAOYSA-N |
| Beilstein/REAXYS | 4752893 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/11955_1_22224_92_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Phacolysin | 3863-80-7 | 2A-9011950 |
| Phenacridane | 3131-08-6 | 2A-9011951 |
| Phenactropinium chloride | 3784-89-2 | 2A-9011952 |
| Phenacyl thiocyanate | 5399-30-4 | 2A-9011953 |
| Phenamazoline | 501-62-2 | 2A-9011954 |
| Phencyclidine hydrochloride | 956-90-1 | 2A-9011957 |
| Phendimetrazine | 634-03-7 | 2A-9011958 |
| Phenethicillin | 147-55-7 | 2A-9011959 |
| Phenformin hydrochloride | 834-28-6 | 2A-9011960 |
| Pheniodol sodium | 7009-60-1 | 2A-9011961 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA