
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 113617-63-3 |
| Catalog No. | 2A-9011782 |
| Chinese Name | 奥比沙星 |
| Synonyms | Orbifloxacin; Orbax; MFCD00864858 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 590.7±50.0 °C at 760 mmHg |
| Melting Point | 260 °C(dec.) |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Storage Condition | Room Temperature |
| Application | Orbifloxacin is a synthetic fluoroquinolone broad-spectrum antibiotic approved for use in dogs. |
| PubChem ID | 329750617 |
| MDL Number | MFCD00864858 |
| SMILES | C[C@@H]1CN(C[C@H](C)N1)c2c(F)c(F)c3C(=O)C(=CN(C4CC4)c3c2F)C(O)=O |
| InChI | 1S/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
| InChI Key | QIPQASLPWJVQMH-DTORHVGOSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/11782_1_113617_63_3.pdf |
| Transport Info | Product Name: Orbifloxacin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Opipramol | 315-72-0 | 2A-9011777 |
| Opratonium iodide | 146919-78-0 | 2A-9011778 |
| Orazamide | 2574-78-9 | 2A-9011779 |
| Orazipone | 137109-78-5 | 2A-9011780 |
| Orbencarb | 34622-58-7 | 2A-9011781 |
| Orbofiban | 163250-90-6 | 2A-9011783 |
| Orbutopril | 108391-88-4 | 2A-9011784 |
| Orciprenaline | 586-06-1 | 2A-9011785 |
| OrientalWaterplantainRhizome | 2A-302869 | 2A-9011786 |
| Orlistat | 96829-58-2 | 2A-0201402 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA