
CAS Number10563-70-9
Synonyms3-(10,10-Dimethyl-9(10H)-anthracenylidene)-N,N-dimethyl-1-propanamine Hydrochloride; 9,10-Dihydro-10,10-dimethyl-9-(3-dimethylaminopropylidene)anthracene Hydrochloride; U 24973A; EINECS 234-150-5; Thymeol hydrochloride; N,N-Dimethyl-3-(10,10-dimethyl-9(10H)-anthrylidene)propylamine Hydrochloride; 3-(10,10-Dimethyl-9(10H)-anthracenylidene)-N,N-dimethyl-1-propanamine hydrochloride (1:1); 9-[3-(Dimethylamino)propylidene]-10,10-dimethyl-9,10-dihydroanthracene Hydrochloride; Dixeran; Melitracene hydrochloride; U-24,973A; MELITRACEN HYDROCHLORIDE; Melitracen HCl; 3-(10,10-Dimethylanthracen-9(10H)-ylidene)-N,N-dimethylpropan-1-amine hydrochloride (1:1); N 7001; Trausabun; N,N,10,10-Tetramethyl-D9(10H),g-anthracenepropylamine Hydrochloride; 1-Propanamine, 3-(10,10-dimethyl-9(10H)-anthracenylidene)
Molecular FormulaC21H26ClN
Molecular Weight327.89
Purity99%
Density1.046 g/cm3
Boiling Point399.1ºC at 760 mmHg
Melting Point245-248ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10563-70-9 |
| Catalog No. | 2A-9011328 |
| Chinese Name | Melitracen hydrochloride |
| Synonyms | 3-(10,10-Dimethyl-9(10H)-anthracenylidene)-N,N-dimethyl-1-propanamine Hydrochloride; 9,10-Dihydro-10,10-dimethyl-9-(3-dimethylaminopropylidene)anthracene Hydrochloride; U 24973A; EINECS 234-150-5; Thymeol hydrochloride; N,N-Dimethyl-3-(10,10-dimethyl-9(10H)-anthrylidene)propylamine Hydrochloride; 3-(10,10-Dimethyl-9(10H)-anthracenylidene)-N,N-dimethyl-1-propanamine hydrochloride (1:1); 9-[3-(Dimethylamino)propylidene]-10,10-dimethyl-9,10-dihydroanthracene Hydrochloride; Dixeran; Melitracene hydrochloride; U-24,973A; MELITRACEN HYDROCHLORIDE; Melitracen HCl; 3-(10,10-Dimethylanthracen-9(10H)-ylidene)-N,N-dimethylpropan-1-amine hydrochloride (1:1); N 7001; Trausabun; N,N,10,10-Tetramethyl-D9(10H),g-anthracenepropylamine Hydrochloride; 1-Propanamine, 3-(10,10-dimethyl-9(10H)-anthracenylidene) |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 327.89 |
| Purity | 99 |
| Density | 1.046 g/cm3 |
| Boiling Point | 399.1ºC at 760 mmHg |
| Melting Point | 245-248ºC |
| Appearance | solid |
| Storage Condition | Refrigerator |
| Application | Melitracen hydrochloride is an orally active bipolar antidepressant and anxiolytic. Melitracen hydrochloride inhibits the uptake of norepinephrine and 5-HT (serotonin) through the presynaptic membrane |
| MDL Number | MFCD00242905 |
| SMILES | [Cl-].[N+H](CCC=C1c2c(cccc2)C(c3c1cccc3)(C)C)(C)C |
| InChI | 1S/C21H25N.ClH/c1-21(2)19-13-7-5-10-17(19)16(12-9-15-22(3)4)18-11-6-8-14-20(18)21;/h5-8,10-14H,9,15H2,1-4H3;1H |
| InChI Key | RADLXCPDUXFGFF-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/11328_1_10563_70_9.pdf |
| Transport Info | Product Name: Merisan Hydrochloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Melanotan II | 121062-08-6 | 2A-9011322 |
| Melanotropin | 581-05-5 | 2A-9011323 |
| Melicopidine | 475-91-2 | 2A-9011325 |
| Melinamide | 14417-88-0 | 2A-9011326 |
| Melitracen | 5118-29-6 | 2A-9011327 |
| meluadrine | 134865-33-1 | 2A-9011331 |
| Menadiol sodium sulfate | 1612-30-2 | 2A-9011332 |
| Meobentine | 46464-11-3 | 2A-9011334 |
| Meperidine hydrochloride | 50-13-5 | 2A-9011335 |
| Mephentermine | 100-92-5 | 2A-9011336 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA