![2,7-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLIC ACID structure, CAS 175201-51-1](/structures/120000/112647_3_175201_51_1.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175201-51-1 |
| Catalog No. | 2A-0112647 |
| Chinese Name | 2,7-二甲基吡唑(1,5-a)嘧啶-6-羧酸 |
| Synonyms | bb_sc-8953; MFCD00067901 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 163.14 |
| Purity | 96+ |
| Density | 1.43g/cm3 |
| Melting Point | 245-247ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| EINECS | 0 |
| HTC | 2933990090 |
| UN(IATA) | 0 |
| SMILES | Cc1cc2ncc(C(=O)O)c(C)n2n1 |
| InChI | InChI=1S/C9H11N3O2/c1-6-3-4-11(2)8-7(9(13)14)5-10-12(6)8/h3-6H,1-2H3,(H,13,14)/p-1/t6-/m1/s1 |
| InChI Key | CACYYYIWDACOAQ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,6-TRANS-DIMETHYLMORPHOLINE | 6485-45-6 | 2A-0112605 |
| 2,7-DICHLORO-4-METHYLQUINOLINE | 59666-16-9 | 2A-0112630 |
| 2,7-DICHLORO-8-METHYLQUINOLINE | 1215205-97-2 | 2A-0112631 |
| 2,7-DICHLOROBENZO[D]OXAZOLE | 86691-34-1 | 2A-0112634 |
| 2,7-DIMETHYL-6-NITROBENZO[D]THIAZOLE | 72206-94-1 | 2A-0112645 |
| 4-bromo-1-iododibenzo[b,d]thiophene | 2A-1112661 | 2A-1112661 |
| 2,8-DICHLOROQUINAZOLINE | 67092-20-0 | 2A-1112664 |
| 2,8-DIMETHYL-2,3,4,4A,5,9B-HEXAHYDRO-1H-PYRIDO[4,3-B]INDOLE | 17411-19-7 | 2A-0112669 |
| 2,9-DI(PYRIDIN-4-YL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE | 136847-29-5 | 2A-0112673 |
| 2,9-DI(THIAZOL-2-YL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE | 171915-93-8 | 2A-0112674 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA