
CAS Number112226-61-6
SynonymsRH 0345; N-tert-butyl-N'-(4-chlorobenzoyl)benzohydrazide; N-tert-Butyl-N'-(4-chlorobenzoyl)benzohydrazide; N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide; 4-chlorobenzoic acid 2-benzoyl-2-(1,1-dimethylethyl)hydrazide; Mach 2; Halofenozide; N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide
Molecular FormulaC18H19ClN2O2
Molecular Weight330.81
Purity≥98.0 (HPLC)%
Density1.205g/cm3
Melting Point198.0-199.0°
EINECS431-600-4
Symbol
Signal WordWarning
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 112226-61-6 |
| Catalog No. | 2A-9010818 |
| Chinese Name | 氯虫酰肼 |
| Synonyms | RH 0345; N-tert-butyl-N'-(4-chlorobenzoyl)benzohydrazide; N-tert-Butyl-N'-(4-chlorobenzoyl)benzohydrazide; N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide; 4-chlorobenzoic acid 2-benzoyl-2-(1,1-dimethylethyl)hydrazide; Mach 2; Halofenozide; N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.81 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.205g/cm3 |
| Melting Point | 198.0-199.0° |
| Packaging | III |
| Application | Halofenozil (RH-0345) is an ecdysteroid agonist. RH-0345 belongs to a new class of insect growth regulators (IGR), which has a benzoyl hydrazide structure and simulates the effects of the natural inse |
| EINECS | 431-600-4 |
| PubChem ID | 329760963 |
| MDL Number | MFCD03158909 |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)cc1)C(=O)c2ccccc2 |
| InChI | 1S/C18H19ClN2O2/c1-18(2,3)21(17(23)14-7-5-4-6-8-14)20-16(22)13-9-11-15(19)12-10-13/h4-12H,1-3H3,(H,20,22) |
| InChI Key | CNKHSLKYRMDDNQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 8421868 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 9 |
| MSDS | msds/10818_1_112226_61_6.pdf |
| Transport Info | Product Name: Halofenozide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Halazone | 80-13-7 | 2A-9010813 |
| Haletazole | 15599-36-7 | 2A-9010814 |
| Halobetasol propionate | 66852-54-8 | 2A-9010815 |
| Halofantrine | 69756-53-2 | 2A-9010816 |
| Halofenate | 26718-25-2 | 2A-9010817 |
| Halofuginone | 55837-20-2 | 2A-9010819 |
| Halofuginone lactate | 82186-71-8 | 2A-9010820 |
| Halometasone hydrate | 50629-82-8 | 2A-9010821 |
| Halquinol | 8067-69-4 | 2A-9010825 |
| Hamburger pentapeptide | 62087-72-3 | 2A-9010826 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA