
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 95311-97-0 |
| Catalog No. | 2A-9010689 |
| Chinese Name | 灵芝酸C1 |
| Synonyms | Ganoderic acid C1; (7|A,25r)-7-hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.65000 |
| Purity | 98 |
| Density | 1.22g/cm3 |
| Boiling Point | 688.3ºC at 760mmHg |
| Melting Point | 150-151 °C |
| Appearance | powder |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Ganoderic acid C1, a natural compound that can be isolated from Ganoderma lucidum. Ganoderma lucidum inhibits the production of TNF-α by mouse macrophages (RAW 264.7 cells) [1]. |
| SMILES | CC(CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3O)C(=O)O |
| InChI | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21,32H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,28+,29-,30+/m1/s1 |
| InChI Key | YTVGSCZIHGRVAV-NJNFCIENSA-N |
| Transport Info | Product Name: Ganoderma Acid C1 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Gallopamil | 16662-47-8 | 2A-9010680 |
| Galtifenin | 106719-74-8 | 2A-9010681 |
| Ganaxolone | 38398-32-2 | 2A-9010684 |
| Ganglefene | 299-61-6 | 2A-9010687 |
| Ganoderic acid A | 81907-62-2 | 2A-9010688 |
| Ganoderma extract | 2A-301773 | 2A-9010690 |
| Ganodermatriol | 105300-28-5 | 2A-9010691 |
| Ganoderol B | 104700-96-1 | 2A-9010692 |
| Gapromidine | 106686-40-2 | 2A-9010693 |
| Garcinia Cambogia | 90045-23-1 | 2A-9010694 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA