
CAS Number1196-28-7
Synonyms2-ethylcarbonylaniline; a-Aminopropiophenone; 1-(2-amino-phenyl)-propan-1-one; 2-aminopropiophenone; 2'-aminopropiophenone; 2-amino-1-phenylpropan-1-one; 1-(2-Aminophenyl)-1-propanone; 1-(2-aminophenyl)propan-1-one; 2-Amino-1-phenyl-1-propanone; Aminopropiophenone; 1-(2-aminophenyl)propanone
Molecular FormulaC11H14O2
Molecular Weight149.190
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point266.9±13.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1196-28-7 |
| Catalog No. | 2A-1104321 |
| Chinese Name | 1-(2-氨基-苯基)-丙烷-1-酮 |
| Synonyms | 2-ethylcarbonylaniline; a-Aminopropiophenone; 1-(2-amino-phenyl)-propan-1-one; 2-aminopropiophenone; 2'-aminopropiophenone; 2-amino-1-phenylpropan-1-one; 1-(2-Aminophenyl)-1-propanone; 1-(2-aminophenyl)propan-1-one; 2-Amino-1-phenyl-1-propanone; Aminopropiophenone; 1-(2-aminophenyl)propanone |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 149.190 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 266.9±13.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2922399090 |
| UN(IATA) | 0 |
| MDL Number | MFCD03424519 |
| SMILES | O=C(CC)C1=CC(C)=CC(C)=C1O |
| InChI | 1S/C11H14O2/c1-4-10(12)9-6-7(2)5-8(3)11(9)13/h5-6,13H,4H2,1-3H3 |
| InChI Key | QZTZOZULRCHDPF-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/104321_1_1196_28_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-AMINO-5-HYDROXYPHENYL)ETHANONE | 30954-71-3 | 2A-0104304 |
| 1-(2-AMINO-5-METHYLPHENYL)-2,2,2-TRIFLUOROETHANONE | 205756-35-0 | 2A-0104305 |
| 1-(2-AMINO-6-CHLORO-9H-PURIN-9-YL)ETHANONE | 470483-92-2 | 2A-0104306 |
| 1-(2-AMINOETHYL)-4,6-DIMETHYLPYRIMIDIN-2(1H)-ONE | 889945-01-1 | 2A-0104311 |
| 1-(2-AMINOETHYL)PYRROLIDIN-2-ONE | 24935-08-8 | 2A-1104314 |
| 1-(2-BROMO-3-FLUOROPHENYL)PROPAN-1-ONE | 1261775-92-1 | 2A-0104327 |
| 1-(2-BROMO-4-FLUOROPHENYL)PYRROLIDIN-2-ONE | 1037150-18-7 | 2A-0104330 |
| 1-(2-BROMO-4-HYDROXYPHENYL)ETHANONE | 61791-99-9 | 2A-0104332 |
| 1-(2-BROMO-4-NITROPHENYL)ETHANONE | 90004-93-6 | 2A-0104333 |
| 1-(2-BROMO-4-NITROPHENYL)PIPERIDIN-4-OL | 1072944-61-6 | 2A-0104334 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA