
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30954-71-3 |
| Catalog No. | 2A-0104304 |
| Chinese Name | 1-(2-氨基-5-羟苯基)乙酮 |
| Synonyms | 4-hydroxy-2-acetyl-aniline |
| Molecular Formula | C8H9O2N1 |
| Molecular Weight | 151.16 |
| Purity | 96+ |
| Density | 1.242g/cm3 |
| Boiling Point | 358.5ºC at 760mmHg |
| Melting Point | 157-161 °C |
| Appearance | brown solid |
| Storage Condition | 2-8°C, dry, sealed |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00100397 |
| SMILES | CC(=O)c1cc(O)ccc1N |
| InChI | InChI=1S/C8H9NO2/c1-5(10)7-4-6(11)2-3-8(7)9/h2-4,11H,9H2,1H3 |
| InChI Key | UAYRCOSFOXJQAB-UHFFFAOYSA-N |
| MSDS | msds/104304_1_30954_71_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-AMINO-4-CHLOROPHENYL)ETHANONE | 39061-72-8 | 2A-0104284 |
| 1-(2-AMINO-4-CHLOROPHENYL)ETHANONE HYDROCHLORIDE | 871928-38-0 | 2A-0104285 |
| 1-(2-AMINO-4-METHOXYPHENYL)ETHANONE HYDROCHLORIDE | 335104-63-7 | 2A-0104294 |
| 1-(2-AMINO-4-METHYLPHENYL)ETHANONE | 122710-21-8 | 2A-0104295 |
| 1-(2-AMINO-5-FLUOROPHENYL)-2,2,2-TRIFLUOROETHANONE | 214288-07-0 | 2A-0104303 |
| 1-(2-AMINO-5-METHYLPHENYL)-2,2,2-TRIFLUOROETHANONE | 205756-35-0 | 2A-0104305 |
| 1-(2-AMINO-6-CHLORO-9H-PURIN-9-YL)ETHANONE | 470483-92-2 | 2A-0104306 |
| 1-(2-AMINOETHYL)-4,6-DIMETHYLPYRIMIDIN-2(1H)-ONE | 889945-01-1 | 2A-0104311 |
| 1-(2-AMINOETHYL)PYRROLIDIN-2-ONE | 24935-08-8 | 2A-1104314 |
| 1-(2-AMINOPHENYL)PROPAN-1-ONE | 1196-28-7 | 2A-1104321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA