
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59989-18-3 |
| Catalog No. | 2A-9010325 |
| Chinese Name | 5-乙炔基尿嘧啶 |
| Synonyms | ethynyluracil; 5-ETHYNYLURACIL; Eniluracil; ethynyluracyl |
| Molecular Formula | C6H4O2N2 |
| Molecular Weight | 136.11 |
| Purity | 95.00 |
| Density | 1.39g/cm3 |
| Melting Point | 320 °C(dec.) |
| Appearance | Solid;White to Light yellow to Light orange powder to crystal |
| Storage Condition | Room temperature, dry |
| Application | Eniluracil (5-Ethynyluracil), a uracil analogue and irreversible inhibitor of dihydropyrimidine dehydrogenase (DPD), increases the oral bioavailability of 5-FU to 100%, promoting uniform absorption an |
| MDL Number | MFCD19160708 |
| SMILES | C#Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H4N2O2/c1-2-4-3-7-6(10)8-5(4)9/h1,3H,(H2,7,8,9,10) |
| InChI Key | JOZGNYDSEBIJDH-UHFFFAOYSA-N |
| MSDS | msds/10325_1_59989_18_3.pdf |
| Transport Info | Product name: 5-ethynyluracil |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Endosulfan | 115-29-7 | 2A-9010320 |
| Endothall | 145-73-3 | 2A-9010321 |
| Endralazine | 39715-02-1 | 2A-9010322 |
| Enfenamic acid | 23049-93-6 | 2A-9010323 |
| Eniclobrate | 60662-18-2 | 2A-9010324 |
| Enlimomab | 142864-19-5 | 2A-9010326 |
| Enlimomab pegol | 169802-84-0 | 2A-9010327 |
| Enloplatin | 111523-41-2 | 2A-9010328 |
| Enocitabine | 55726-47-1 | 2A-9010329 |
| Enoxacin | 74011-58-8 | 2A-9010330 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA