
CAS Number17109-49-8
SynonymsMFCD00078673; O-ethyl S,S-diphenyl phosphorodithioate; Edifenphos; EINECS 241-178-1; [ethoxy(phenylsulfanyl)phosphoryl]sulfanylbenzene; EDDP
Molecular FormulaC14H15O2PS2
Molecular Weight310.37
Purity98%
Density1.27 g/cm3
Boiling Point430.2ºC at 760 mmHg
AppearanceYellow to brown liquid with a characteristic odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17109-49-8 |
| Catalog No. | 2A-9010280 |
| Chinese Name | 敌瘟磷 |
| Synonyms | MFCD00078673; O-ethyl S,S-diphenyl phosphorodithioate; Edifenphos; EINECS 241-178-1; [ethoxy(phenylsulfanyl)phosphoryl]sulfanylbenzene; EDDP |
| Molecular Formula | C14H15O2PS2 |
| Molecular Weight | 310.37 |
| Purity | 98 |
| Density | 1.27 g/cm3 |
| Boiling Point | 430.2ºC at 760 mmHg |
| Appearance | Yellow to brown liquid with a characteristic odor |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | III |
| HTC | 2930909058 |
| MDL Number | MFCD00078673 |
| SMILES | CCOP(=O)(Sc1ccccc1)Sc2ccccc2 |
| InChI | 1S/C14H15O2PS2/c1-2-16-17(15,18-13-9-5-3-6-10-13)19-14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChI Key | AWZOLILCOUMRDG-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1988797 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/10280_1_17109_49_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | S (Import and export pesticide registration certificate) |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Echinocystic acid | 510-30-5 | 2A-9010275 |
| Echlomezol | 2593-15-9 | 2A-9010276 |
| Ecipramidil | 64552-16-5 | 2A-9010277 |
| Econazole | 27220-47-9 | 2A-9010278 |
| Econazole nitrate | 24169-02-6 | 2A-9010279 |
| Edifolone | 90733-40-7 | 2A-9010281 |
| Edobacomab | 141410-98-2 | 2A-9010282 |
| Edrecolomab | 156586-89-9 | 2A-9010283 |
| Edunol | 37706-60-8 | 2A-9010284 |
| Efaroxan | 89197-32-0 | 2A-9010285 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA