
CAS Number97-17-6
SynonymsO-2,4-dichlorophenyl O,O-diethyl phosphorothioate; Dichlofenthion; (2,4-dichlorophenoxy)-diethoxy-sulfanylidene-λ<sup>5</sup>-phosphane; O-(2,4-dichlorophenyl) O,O-diethyl phosphorothioate; EINECS 202-564-5; MFCD00045182
Molecular FormulaC10H13Cl2O3PS
Molecular Weight318.17
Purity97 (CP)%
Density1.313
Boiling Point166(0.0133kPa)
Melting Point100ºC
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97-17-6 |
| Catalog No. | 2A-9010111 |
| Chinese Name | 除线磷 |
| Synonyms | O-2,4-dichlorophenyl O,O-diethyl phosphorothioate; Dichlofenthion; (2,4-dichlorophenoxy)-diethoxy-sulfanylidene-λ<sup>5</sup>-phosphane; O-(2,4-dichlorophenyl) O,O-diethyl phosphorothioate; EINECS 202-564-5; MFCD00045182 |
| Molecular Formula | C10H13Cl2O3PS |
| Molecular Weight | 318.17 |
| Purity | 97 (CP) |
| Density | 1.313 |
| Boiling Point | 166(0.0133kPa) |
| Melting Point | 100ºC |
| Appearance | liquid |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| Packaging | III |
| HTC | 2920190090 |
| PubChem ID | 329763578 |
| MDL Number | MFCD18827460 |
| SMILES | [2H]c1c([2H])c(OP(=S)(OCC)OCC)c(Cl)c([2H])c1Cl |
| InChI | 1S/C10H13Cl2O3PS/c1-3-13-16(17,14-4-2)15-10-6-5-8(11)7-9(10)12/h5-7H,3-4H2,1-2H3/i5D,6D,7D |
| InChI Key | WGOWCPGHOCIHBW-CRSPMMAGSA-N |
| UNSPSC | 12352101 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/10111_1_97_17_6.pdf |
| Use of | Dichlofenthion is a phosphorothioate which is primarily used as a pesticide and nematicide. Properties Name dichlofenthion Synonym More Synonyms Chemical & Physical Properties Exact Mass 313.97000 PSA 69.59000 LogP 5.32030 Index of Refraction 1.545 InChIKey WGOWCPGHOCIHBW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dibromsalan | 87-12-7 | 2A-9010106 |
| Cinchocaine base | 85-79-0 | 2A-9010107 |
| Dibucaine hydrochloride; Cinchocaine Hcl | 61-12-1 | 2A-9010108 |
| Dicarbasulf | 59669-26-0 | 2A-9010109 |
| Dichlobutrazol | 75736-33-3 | 2A-9010110 |
| Dichlofluanid | 1085-98-9 | 2A-9010112 |
| Dichloralphenazone | 480-30-8 | 2A-9010113 |
| Dichloramine T | 473-34-7 | 2A-9010114 |
| Dichlorbenzalkonium chloride | 8023-53-8 | 2A-9010115 |
| Dichloroisoproterenol | 59-61-0 | 2A-9010116 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA