
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 524-17-4 |
| Catalog No. | 2A-9010013 |
| Chinese Name | 蝙蝠葛碱 |
| Synonyms | 6,6'-Di-O-Methyldauricoline; Dauricine; Menispermum dauricum DC Extract |
| Molecular Formula | C38H44N2O6 |
| Molecular Weight | 624.78 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 712.3±60.0 °C at 760 mmHg |
| Melting Point | 115ºC |
| Appearance | white powder |
| Storage Condition | 2-8 °C |
| Application | Dauricine is a diphenylisoquinoline alkaloid found in Asiatic Moonseed Rhizome and has anti-inflammatory activity. Dauricine inhibits the proliferation and invasion of colon cancer cells and induces a |
| MDL Number | C38H44N2O6 |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(Oc3cc(CC4c5cc(OC)c(OC)cc5CCN4C)ccc3O)cc1)N(C)CC2 |
| InChI | InChI=1S/C38H44N2O6/c1-39-15-13-26-20-35(42-3)37(44-5)22-29(26)31(39)17-24-7-10-28(11-8-24)46-34-19-25(9-12-33(34)41)18-32-30-23-38(45-6)36(43-4)21-27(30)14-16-40(32)2/h7-12,19-23,31-32,41H,13-18H2,1-6H3 |
| InChI Key | AQASRZOCERRGBL-ROJLCIKYSA-N |
| MSDS | msds/10013_1_524_17_4.pdf |
| Transport Info | Product name: Pueraria lobata |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Darsidomine | 137500-42-6 | 2A-9010008 |
| Dasatinib | 302962-49-8 | 2A-9010009 |
| Dasatinib monohydrate | 863127-77-9 | 2A-9010010 |
| Datiscetin | 480-15-9 | 2A-9010011 |
| Daunorubicin hydrochloride | 23541-50-6 | 2A-9010012 |
| Dazolicine | 61477-97-2 | 2A-9010014 |
| Dazoxiben | 78218-09-4 | 2A-9010016 |
| Deae dextran | 9015-73-0 | 2A-9010018 |
| Debrisoquine | 1131-64-2 | 2A-9010019 |
| Debropol | 24403-04-1 | 2A-9010020 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA