| Chemical & Physical Properties | |
|---|---|
| CAS Number | 161832-74-2 |
| Catalog No. | 2A-0099678 |
| Chinese Name | (R)-(+)-2-氨基-4-甲基-1,1-二苯基-1-戊醇 |
| Synonyms | MFCD03093530 |
| Molecular Formula | C27H24O5N2 |
| Molecular Weight | 456.5 |
| Purity | 96+ |
| Density | 1.059 g/cm3 |
| Boiling Point | 436.6ºC at 760 mmHg |
| Melting Point | 144-147ºC(lit.) |
| Appearance | White crystal |
| Storage Condition | Room temperature, airtight, protected from light |
| EINECS | 0 |
| HTC | 2922199090 |
| UN(IATA) | 0 |
| MDL Number | MFCD22665734 |
| SMILES | CC(C)CC(N)C(O)(c1ccccc1)c1ccccc1 |
| InChI Key | XECSMDWXBMBRDE-QGZVFWFLSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-AMINO-3-CHLOROPROPANOIC ACID HYDROCHLORIDE | 51887-88-8 | 2A-0099667 |
| (R)-2-AMINO-3-CYCLOBUTYLPROPANOIC ACID | 174266-00-3 | 2A-0099668 |
| (R)-2-AMINO-3-HYDROXY-2-(4-HYDROXYBENZYL)PROPANOIC ACID | 134309-86-7 | 2A-0099670 |
| (R)-2-AMINO-3-METHYLSUCCINIC ACID | 43176-54-1 | 2A-0099676 |
| (R)-2-AMINO-4-(AMINOOXY)BUTANOIC ACID | 128395-79-9 | 2A-0099677 |
| (R)-2-AMINO-4-METHYLPENTANAMIDE | 15893-47-7 | 2A-0099679 |
| (R)-2-AMINO-5,5,5-TRIFLUOROPENTANAMIDE | 1146852-37-0 | 2A-0099681 |
| (R)-2-AMINO-5,5,5-TRIFLUOROPENTANAMIDE HYDROCHLORIDE | 1146699-58-2 | 2A-0099682 |
| (R)-2-AMINO-5-(((BENZYLOXY)CARBONYL)AMINO)PENTANOIC ACID | 16937-91-0 | 2A-0099683 |
| (R)-2-AMINO-5-(TERT-BUTOXY)-5-OXOPENTANOIC ACID | 45125-00-6 | 2A-0099684 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA