
CAS Number860-79-7
SynonymsMFCD00468040; bebuxine; cyclovirobuxind; cyclovirobuxinum D; cyclobuxine D; (3β,5α,9β,16α,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol; cvb-d; Cyclovirobuxine-D; CYCLOVIROBUXINE
Molecular FormulaC26H46N2O
Molecular Weight402.66
Purity≥90 (HPLC)%
Density1.1±0.1 g/cm3
Boiling Point495.7±10.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 860-79-7 |
| Catalog No. | 2A-9009962 |
| Chinese Name | 黄杨碱; 环维黄杨星D |
| Synonyms | MFCD00468040; bebuxine; cyclovirobuxind; cyclovirobuxinum D; cyclobuxine D; (3β,5α,9β,16α,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol; cvb-d; Cyclovirobuxine-D; CYCLOVIROBUXINE |
| Molecular Formula | C26H46N2O |
| Molecular Weight | 402.66 |
| Purity | ≥90 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 495.7±10.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8C |
| Application | Cyclovirobuxine D (CVB-D) is the main active ingredient in the traditional Chinese medicine Buxus microphylla. Cyclovirobuxine D induces autophagy and attenuates the phosphorylation of Akt and mTOR. C |
| MDL Number | MFCD00468040 |
| SMILES | C[C@H](NC)[C@@]1([H])[C@H](O)C[C@@]2(C)[C@]3([H])CC[C@@]4([H])C(C)(C)[C@@H](NC)CC[C@]4(C5)[C@]35CC[C@@]21C |
| InChI | 1S/C26H46N2O/c1-16(27-6)21-17(29)14-24(5)19-9-8-18-22(2,3)20(28-7)10-11-25(18)15-26(19,25)13-12-23(21,24)4/h16-21,27-29H,8-15H2,1-7H3/t16-,17+,18-,19-,20-,21-,23+,24-,25+,26-/m0/s1 |
| InChI Key | GMNAPBAUIVITMI-ABNIRSKTSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 51111800 |
| MSDS | msds/9962_1_860_79_7.pdf |
| Transport Info | Product name: Ring-dimensional boxwood star D |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cycloprothrin | 63935-38-6 | 2A-9009955 |
| Cyclosporin B | 63775-95-1 | 2A-0202360 |
| Cyclosporin C | 59787-61-0 | 2A-9009957 |
| Cyclosporin D | 63775-96-2 | 2A-0202361 |
| Cyclosporin H | 83602-39-5 | 2A-9009959 |
| Cycloxidim | 101205-02-1 | 2A-9009963 |
| Cymarol | 465-84-9 | 2A-9009965 |
| Cynarine | 1884-24-8 | 2A-9009967 |
| Cyprodinil | 121552-61-2 | 2A-9009969 |
| Cyproheptadine hydrochloride | 41354-29-4 | 2A-9009970 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA