
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4410-12-2 |
| Catalog No. | 2A-9000982 |
| Chinese Name | 1-苄基高哌嗪 |
| Synonyms | 1-Benzyl-1,4-diazepane; 1-Benzylhomopiperazine; MFCD00800858 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.28500 |
| Purity | 98 |
| Density | 1.028 g/mL at 25 °C |
| Boiling Point | 93 °C |
| Appearance | colorless liquid |
| Storage Condition | Keep away from light, ventilated and dry, sealed |
| Packaging | III |
| HTC | 2933990090 |
| SMILES | c1ccc(CN2CCCNCC2)cc1 |
| InChI | InChI=1S/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
| InChI Key | JTJTYCPQUOROFM-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Risk Codes | 22-36/37/38 |
| Safety Description | 26-36 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Benzyl-4,4-difluoropiperidine | 155137-18-1 | 2A-9000976 |
| 1-Benzyl-4-aminopiperidine dihydrochloride | 50541-93-1 | 2A-9000977 |
| 1-Benzyl-4-fluoropiperidine | 764664-42-8 | 2A-9000978 |
| 1-Benzyl-4-hydroxypiperidine | 4727-72-4 | 2A-9000979 |
| 1-Benzyl-4-iodo-1H-pyrazole | 50877-42-4 | 2A-9000980 |
| 1-Benzylindole-3-carboxylic acid | 27018-76-4 | 2A-9000983 |
| 1-Benzyloxycarbonylpiperidine-3-carbonyl chloride | 216502-94-2 | 2A-9000988 |
| 1-Benzylpiperazine | 2759-28-6 | 2A-9000990 |
| 1-Benzyl Piperazine HCL | 72878-35-4 | 2A-9000991 |
| 1-Benzylpiperidine-4-carboxylic acid ethyl ester | 24228-40-8 | 2A-9000992 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA