
CAS Number145965-14-6
Synonyms4-Bromo-1-naphthaleneboronic acid; 4-bromonaphthalen-1-ylboronic acid; 4-BROMONAPHTHALENE-1-BORONIC ACID; (4-Bromo-1-naphthyl)boronic acid; 1-Bromonaphthalene-4-boronic acid
Molecular FormulaC10H8BBrO2
Molecular Weight248.08
Purity96+%
Density1.6±0.1 g/cm3
Boiling Point421.7±47.0 °C at 760 mmHg
Melting Point230-260ºC
Appearancesolid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 145965-14-6 |
| Catalog No. | 2A-0097540 |
| Chinese Name | 4-溴-1-萘硼酸 |
| Synonyms | 4-Bromo-1-naphthaleneboronic acid; 4-bromonaphthalen-1-ylboronic acid; 4-BROMONAPHTHALENE-1-BORONIC ACID; (4-Bromo-1-naphthyl)boronic acid; 1-Bromonaphthalene-4-boronic acid |
| Molecular Formula | C10H8BBrO2 |
| Molecular Weight | 248.08 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 421.7±47.0 °C at 760 mmHg |
| Melting Point | 230-260ºC |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2931900090 |
| UN(IATA) | 0 |
| PubChem ID | 329774590 |
| MDL Number | MFCD08669639 |
| SMILES | OB(O)C1=CC=C(C2=C(C=CC=C3)C3=CC=C2)C=C1 |
| InChI | 1S/C16H13BO2/c18-17(19)14-10-8-13(9-11-14)16-7-3-5-12-4-1-2-6-15(12)16/h1-11,18-19H |
| InChI Key | BQHVXFQXTOIMQM-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/97540_1_145965_14_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 4-Bromo-1-naphthylboronic acid (with varying amounts of anhydride) Module 14. Shipping information UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| (4-BROMO-3-CHLOROPHENYL)BORONIC ACID | 1217501-28-4 | 2A-0097526 |
| (4-BROMO-3-METHOXYPHENYL)BORONIC ACID | 1256345-59-1 | 2A-0097529 |
| (4-BROMO-3-METHYLPHENYL)BORONIC ACID | 221006-67-3 | 2A-0097531 |
| (4-BROMO-5-CHLOROTHIOPHEN-2-YL)BORONIC ACID | 1150114-72-9 | 2A-0097534 |
| (4-BROMOBUTYL)BORONIC ACID | 61632-72-2 | 2A-0097539 |
| (4-BROMOTHIOPHEN-2-YL)BORONIC ACID | 499769-92-5 | 2A-0097567 |
| (4-BUTOXY-2,3-DIFLUOROPHENYL)BORONIC ACID | 156487-12-6 | 2A-0097573 |
| (4-BUTOXY-2-FLUOROPHENYL)BORONIC ACID | 1107603-52-0 | 2A-0097574 |
| (4-BUTOXY-3,5-DICHLOROPHENYL)BORONIC ACID | 1218790-72-7 | 2A-0097575 |
| (4-BUTOXY-3,5-DIMETHYLPHENYL)BORONIC ACID | 845551-41-9 | 2A-0097576 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA