
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27724-96-5 |
| Catalog No. | 2A-9009711 |
| Chinese Name | 盐酸西曲酸酯 |
| Synonyms | 3-[4-[4-(aminomethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid,hydrochloride |
| Molecular Formula | C17H24O4N1Cl1 |
| Molecular Weight | 341.83 |
| Purity | 99 |
| Density | 1.182g/cm3 |
| Boiling Point | 480.9ºC at 760mmHg |
| Melting Point | 238-240ºC |
| Storage Condition | Warehouse low temperature ventilation and drying |
| Application | Cetrixadine hydrochloride (DV-1006), an orally active anti-ulcer agent with mucosal protection, can be used in gastric ulcer research [1]. Cetrixadine hydrochloride is a potent inhibitor of acrosome p |
| MDL Number | MFCD16039388 |
| SMILES | Cl.NCC1CCC(C(=O)Oc2ccc(CCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C17H23NO4.ClH/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20;/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20);1H |
| InChI Key | USROQQUKEBHOFF-UHFFFAOYSA-N |
| MSDS | msds/9711_1_27724_96_5.pdf |
| Transport Info | Product Name: Cetrixate Hydrochloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cetermin | 157238-32-9 | 2A-9009705 |
| Cetiedil | 14176-10-4 | 2A-9009706 |
| Cetirizine | 83881-51-0 | 2A-9009707 |
| Cetirizine hydrochloride | 83881-52-1 | 2A-9009709 |
| Cetraxate | 34675-84-8 | 2A-9009710 |
| Chartreusin | 6377-18-0 | 2A-9009712 |
| Chaste tree fruitextract | 2A-300796 | 2A-9009713 |
| Chenodeoxycholic acid | 474-25-9 | 2A-9009715 |
| Chlomethocillin | 1926-49-4 | 2A-9009717 |
| Chlomethoxynil | 32861-85-1 | 2A-9009718 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA