
CAS Number5274-99-7
SynonymsEINECS 226-099-2; MFCD00040747; 1-Benzoyl-4-piperidinecarboxylic acid; 1-Benzoylpiperidine-4-carboxylic acid
Molecular FormulaC13H15NO3
Molecular Weight233.269
Purity98%
Density1.2±0.1 g/cm3
Boiling Point438.8±38.0 °C at 760 mmHg
Melting Point144-146ºC
AppearanceWhite to off-white crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5274-99-7 |
| Catalog No. | 2A-9000963 |
| Chinese Name | 1-苯甲酰哌啶-4-羧酸 |
| Synonyms | EINECS 226-099-2; MFCD00040747; 1-Benzoyl-4-piperidinecarboxylic acid; 1-Benzoylpiperidine-4-carboxylic acid |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.269 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 438.8±38.0 °C at 760 mmHg |
| Melting Point | 144-146ºC |
| Appearance | White to off-white crystals |
| Storage Condition | Room Temperature |
| HTC | 2933399090 |
| MDL Number | MFCD00040747 |
| SMILES | O=C(O)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H15NO3/c15-12(10-4-2-1-3-5-10)14-8-6-11(7-9-14)13(16)17/h1-5,11H,6-9H2,(H,16,17) |
| InChI Key | ZTGMNCCDDKBPML-UHFFFAOYSA-N |
| MSDS | msds/963_1_5274_99_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Benzoyl-3,5-bis(perfluorohexyl)pyrazole | 2A-100956 | 2A-9000956 |
| 1-Benzoyl-3,5-bis(perfluoropropyl)pyrazole | 2A-100957 | 2A-9000957 |
| 1-Benzoyl-3,5-bis(trifluoromethyl)pyrazole | 134947-25-4 | 2A-9000958 |
| 1-Benzoyl-5(3)-methyl-3(5)-trifluoromethylpyrazole | 2A-100961 | 2A-9000961 |
| 1-Benzoylpiperazine | 13754-38-6 | 2A-9000962 |
| 1-Benzyl-1H-pyrrole-2,5-dione | 1631-26-1 | 2A-9000965 |
| 1-Benzyl-2,3-dimethyl-1H-indole-5-carboxylic acid | 313498-12-3 | 2A-9000967 |
| 1-Benzyl-3,3-difluoropiperidine | 2A-100970 | 2A-9000970 |
| 1-Benzyl-3-aminopyrrolidine | 18471-40-4 | 2A-9000971 |
| 1-Benzyl-3-hydroxy-1H-indazole | 2215-63-6 | 2A-9000972 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA