
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 113928-90-8 |
| Catalog No. | 2A-0096217 |
| Chinese Name | (3-氨基-4-甲氧基苯基)甲醇 |
| Synonyms | Benzenemethanol,3-amino-4-methoxy; 3-Amino-4-methoxy-benzylalkohol; 3-amino-4-methoxy-benzyl alcohol |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 |
| Purity | 96+ |
| Storage Condition | Room temperature, protected from light, stored in |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 86713194 |
| SMILES | COc1ccc(CO)cc1N |
| InChI | InChI=1S/C8H11NO2/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4,10H,5,9H2,1H3 |
| InChI Key | WPUAJRPNIWMHET-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Industrial Applications | ||
|---|---|---|
| (3-(BENZYLOXY)-4-METHOXYPHENYL)METHANOL | 1860-60-2 | 2A-0096066 |
| (3-(BENZYLOXY)PHENYL)METHANOL | 1700-30-7 | 2A-0096076 |
| (3-(O-TOLYL)ISOXAZOL-5-YL)METHANOL | 885273-56-3 | 2A-0096160 |
| (3-(TERT-BUTOXY)PHENYL)METHANOL | 64859-35-4 | 2A-0096174 |
| (3-(TERT-BUTYL)PHENYL)METHANOL | 51503-09-4 | 2A-0096179 |
| (3-AMINO-5,6-DICHLOROPYRAZIN-2-YL)METHANOL | 95037-20-0 | 2A-0096220 |
| (3-AMINO-6-BROMOPYRAZIN-2-YL)METHANOL | 1260880-59-8 | 2A-0096233 |
| (3-AMINONAPHTHALEN-2-YL)METHANOL | 141281-58-5 | 2A-0096242 |
| (3-AMINOPYRAZIN-2-YL)METHANOL | 32710-13-7 | 2A-0096254 |
| (3-AMINOPYRIDIN-2-YL)METHANOL | 52378-63-9 | 2A-0096257 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA