
CAS Number90729-42-3
Synonymsp-(4-(4-(Diphenylmethoxy)piperidino)butyryl)-a-methylhydratropic Acid; Carebastinum; carebastine; 2-(4-{4-[4-(Diphenylmethoxy)piperidin-1-yl]butanoyl}phenyl)-2-methylpropanoic acid; 4-(4-(4-(Diphenylmethoxy)-1-piperidinyl)-1-oxobutyl)-a,a-dimethylbenzeneacetic Acid; Carebastina; C32H37NO4; UNII-75DLN707DO; 2-(4-{4-[4-(Diphenylmethoxy)-1-piperidinyl]butanoyl}phenyl)-2-methylpropanoic acid
Molecular FormulaC32H37NO4
Molecular Weight499.65
Purity98%
Density1.2±0.1 g/cm3
Boiling Point657.9±55.0 °C at 760 mmHg
Melting Point178-180ºC
Appearanceoff-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90729-42-3 |
| Catalog No. | 2A-9009591 |
| Chinese Name | 卡瑞斯汀 |
| Synonyms | p-(4-(4-(Diphenylmethoxy)piperidino)butyryl)-a-methylhydratropic Acid; Carebastinum; carebastine; 2-(4-{4-[4-(Diphenylmethoxy)piperidin-1-yl]butanoyl}phenyl)-2-methylpropanoic acid; 4-(4-(4-(Diphenylmethoxy)-1-piperidinyl)-1-oxobutyl)-a,a-dimethylbenzeneacetic Acid; Carebastina; C32H37NO4; UNII-75DLN707DO; 2-(4-{4-[4-(Diphenylmethoxy)-1-piperidinyl]butanoyl}phenyl)-2-methylpropanoic acid |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 657.9±55.0 °C at 760 mmHg |
| Melting Point | 178-180ºC |
| Appearance | off-white solid |
| Storage Condition | -20°C, sealed, dry |
| Application | Carebastine is the active metabolite of Ebastine. Carebastine is a histamine H1 receptor antagonist. Carebastine inhibits VEGF-induced HUVEC and HPAEC proliferation, migration and angiogenesis. Careba |
| MDL Number | C32H37NO4 |
| SMILES | CC(C)(C(=O)O)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H37NO4/c1-32(2,31(35)36)27-17-15-24(16-18-27)29(34)14-9-21-33-22-19-28(20-23-33)37-30(25-10-5-3-6-11-25)26-12-7-4-8-13-26/h3-8,10-13,15-18,28,30H,9,14,19-23H2,1-2H3,(H,35,36) |
| InChI Key | XGHOVGYJHWQGCC-UHFFFAOYSA-N |
| MSDS | msds/9591_1_90729_42_3.pdf |
| Transport Info | Product Name: Carebastine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Carbocromen | 804-10-4 | 2A-9009581 |
| Carbophenothion | 786-19-6 | 2A-9009586 |
| Carbosulfan | 55285-14-8 | 2A-9009588 |
| Carboxin | 5234-68-4 | 2A-9009589 |
| Carcainium chloride | 1042-42-8 | 2A-9009590 |
| Cariporide | 159138-80-4 | 2A-9009592 |
| Cariporide | 159138-80-3 | 2A-9009593 |
| Carisoprodol | 78-44-4 | 2A-9009594 |
| Carlinoside | 59952-97-5 | 2A-9009595 |
| Carmine | 1390-65-4 | 2A-9009596 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA