
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 614-23-3 |
| Catalog No. | 2A-9000953 |
| Chinese Name | N-苯甲酰硫脲 |
| Synonyms | N-Carbamothioylbenzamide; N-Benzoylthiourea; MFCD00041191 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.227 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 319.5ºC at 760 mmHg |
| Melting Point | 174-176°C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Water solubility: insoluble |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| HTC | 3822.00.5090 |
| SMILES | NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8N2OS/c9-8(12)10-7(11)6-4-2-1-3-5-6/h1-5H,(H3,9,10,11,12) |
| InChI Key | DQMWMUMCNOJLSI-UHFFFAOYSA-N |
| MSDS | msds/953_1_614_23_3.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Androstene-3,17-diol | 14291-94-2 | 2A-9000945 |
| 1-Androstene-3,17-dione | 21507-41-5 | 2A-9000946 |
| 1-Benzhydryl-2-thiourea | 92192-94-4 | 2A-9000947 |
| 1-Benzothiophen | 95-15-8 | 2A-9000950 |
| 1-Benzoyl-2-thiobiuret | 41835-24-9 | 2A-9000952 |
| 1-Benzoyl-3-(2-pyridyl)-2-thiourea | 4921-86-2 | 2A-9000954 |
| 1-Benzoyl-3-phenyl-2-thiourea | 4921-82-8 | 2A-9000959 |
| 1-Benzyl-1-methoxy-3-phenylurea | 149281-90-3 | 2A-9000966 |
| 1-Benzyl-2-thiourea | 621-83-0 | 2A-9000968 |
| 1-Benzyl-3-(4-chlorophenyl)-1-methoxyurea | 149282-10-0 | 2A-9000969 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA