
CAS Number86-22-6
SynonymsBrompheniramine; MFCD00865691; EINECS 201-657-8; (±)-1-(4-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane; (±)-brompheniramine
Molecular FormulaC16H19BrN2
Molecular Weight319.247
Purity98%
Density1.265 g/cm3
Boiling Point403ºC at 760 mmHg
AppearanceThe oily liquid is slightly yellow and has a unique amine-like smell.
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86-22-6 |
| Catalog No. | 2A-9009456 |
| Chinese Name | 溴苯那敏 |
| Synonyms | Brompheniramine; MFCD00865691; EINECS 201-657-8; (±)-1-(4-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane; (±)-brompheniramine |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.247 |
| Purity | 98 |
| Density | 1.265 g/cm3 |
| Boiling Point | 403ºC at 760 mmHg |
| Appearance | The oily liquid is slightly yellow and has a unique amine-like smell. |
| Storage Condition | 2-8°C |
| Application | Brompheniramine (±)-brompheniramine) is a potent orally active alkylamine antihistamine. Brompheniramine is a selective histamine H1 receptor antagonist with a Kd of 6.06 nM. Brompheniramine can block |
| MDL Number | MFCD00865691 |
| SMILES | CN(C)CCC(c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| InChI Key | ZDIGNSYAACHWNL-UHFFFAOYSA-N |
| MSDS | msds/9456_1_86_22_6.pdf |
| Transport Info | Product Name: Brompheniramine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bromocyclen | 1715-40-8 | 2A-9009451 |
| Bromohexine hydrochloride | 611-75-6 | 2A-9009452 |
| Bromophos-methyl | 2104-96-3 | 2A-9009453 |
| Bromopropylate | 18181-80-1 | 2A-9009454 |
| Bromperidol | 10457-90-6 | 2A-9009455 |
| Broquinaldol | 15599-52-7 | 2A-9009457 |
| Brotizolam | 57801-81-7 | 2A-9009458 |
| Brovincamine | 57475-17-9 | 2A-9009459 |
| Broxaldine | 3684-46-6 | 2A-9009460 |
| Broxitalamic acid | 86216-41-3 | 2A-9009461 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA