
CAS Number600-30-6
Synonyms2,3-Dibrom-buttersaeure; EINECS 209-992-1; 2,3-Dibromobutyric acid; Butanoic acid,2,3-dibromo; MFCD00014334
Molecular FormulaC4H6Br2O2
Molecular Weight245.899
Purity98.00%
Density2.114g/cm3
Boiling Point100-110°C 2mm
Melting Point86-90 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 600-30-6 |
| Catalog No. | 2A-9093986 |
| Chinese Name | 2,3-二溴丁酸 |
| Synonyms | 2,3-Dibrom-buttersaeure; EINECS 209-992-1; 2,3-Dibromobutyric acid; Butanoic acid,2,3-dibromo; MFCD00014334 |
| Molecular Formula | C4H6Br2O2 |
| Molecular Weight | 245.899 |
| Purity | 98.00 |
| Density | 2.114g/cm3 |
| Boiling Point | 100-110°C 2mm |
| Melting Point | 86-90 °C |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | II |
| HTC | 2915900090 |
| PubChem ID | 72197 |
| MDL Number | MFCD00014334 |
| SMILES | CC(Br)C(Br)C(=O)O |
| InChI | InChI=1S/C4H6Br2O2/c1-2(5)3(6)4(7)8/h2-3H,1H3,(H,7,8) |
| InChI Key | HESQKTULJLBDRF-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/93986_1_600_30_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ospemifene-d4 | 2A-175619 | 2A-9093976 |
| N-Desmethyl Ivabradine D6 HCl | 1346600-74-5 | 2A-9093979 |
| Palbocicub-d8 | 2A-175623 | 2A-9093980 |
| 2-AMINO-2-METHYLBUTYRIC ACID | 465-58-7 | 2A-9093983 |
| SODIUM TRIMETHOXYBOROHYDRIDE | 16940-17-3 | 2A-9093985 |
| 2-amino-3-[3-[5-(2-amino-3-hydroxy-3-oxopropyl)-2-hydroxyphenyl]-4-hydroxyphenyl]propanoic acid | 980-21-2 | 2A-9093987 |
| propamidine isetionate | 140-63-6 | 2A-9093989 |
| (+/-)-JASMONIC ACID | 77026-92-7 | 2A-9093990 |
| CYCLODECANE | 293-96-9 | 2A-9093994 |
| AvibactaM | 1192500-31-4 | 2A-9093995 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA