
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1448232-80-1 |
| Catalog No. | 2A-9093744 |
| Chinese Name | Naquotinib |
| Synonyms | Naquotinib; UNII-47DD4548PB; ASP8273 |
| Molecular Formula | C30H42O3N8 |
| Molecular Weight | 562.72 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 717.6±60.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Naquotinib (ASP8273) is an orally active, irreversible inhibitor of EGFR mutants; the IC50 values for EGFR mutants and EGFR are 8-33 and 230 nM, respectively. |
| PubChem ID | 163834829 |
| MDL Number | MFCD30496701 |
| SMILES | C=CC(=O)N1CCC(Oc2nc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)cc3)c(C(N)=O)nc2CC)C1 |
| InChI | InChI=1S/C30H42N8O3/c1-4-25-30(41-24-12-15-38(20-24)26(39)5-2)34-29(27(33-25)28(31)40)32-21-6-8-22(9-7-21)36-13-10-23(11-14-36)37-18-16-35(3)17-19-37/h5-9,23-24H,2,4,10-20H2,1,3H3,(H2,31,40)(H,32,34)/t24-/m1/s1 |
| InChI Key | QKDCLUARMDUUKN-XMMPIXPASA-N |
| MSDS | msds/93744_1_1448232_80_1.pdf |
| Transport Info | Product Name: Naquotinib(ASP8273) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-[(1E,3R)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol | 96895-25-9 | 2A-9093734 |
| 3-hydroxypropanoyl chloride | 109608-73-3 | 2A-9093736 |
| AM 103 | 1147872-22-7 | 2A-9093737 |
| 2-Bromo-7-chloronaphthalene | 321939-67-7 | 2A-9093738 |
| CEP-28122 | 1022958-60-6 | 2A-9093740 |
| 2-chloro-3-hydroxyPropanal | 28598-66-5 | 2A-9093745 |
| Glecaprevir | 1365970-03-1 | 2A-9093746 |
| XANTHORRHIZOL | 30199-26-9 | 2A-9093747 |
| Aspergillus oryzae | 68038-56-2 | 2A-9093748 |
| Sacubitril Sodium Salt | 149690-05-1 | 2A-9093749 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA