
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16227-12-6 |
| Catalog No. | 2A-9093354 |
| Chinese Name | 4-苯基-4H-1,2,4-三唑 |
| Synonyms | 4-phenyl-4H-1,2,4-triazine; 1-phenyl 1,3,4-triazole; 4-benzene-1,2,4-triazole; 4-Phenyl-1H-1,2,4-triazole; 1H-1,2,4-Triazole,4-phenyl |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 |
| Density | 1.16 g/cm3 |
| Boiling Point | 292.3ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 5412654 |
| SMILES | c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C8H7N3/c1-2-4-8(5-3-1)11-6-9-10-7-11/h1-7H |
| InChI Key | YAHHNSBXSDGEFB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-PyriMidinedicarboxylic acid, 5-Methyl ester | 115600-17-4 | 2A-9093316 |
| 2,3-DIMETHYL-4-PYRIDINECARBONITRILE | 131895-50-6 | 2A-9093333 |
| 2,6-dimethyl-4-pyridinecarbothioamide | 80653-65-2 | 2A-9093335 |
| ethyl 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate | 1260169-02-5 | 2A-9093347 |
| 4-broMo-2-tert-butylpyridine | 1086381-30-7 | 2A-9093350 |
| Ethyl 4-forMylthiophene-3-carboxylate | 67808-74-6 | 2A-9093360 |
| Ethyl 2-forMylthiophene-3-carboxylate | 67808-70-2 | 2A-9093363 |
| (2S)-2-Morpholinemethanol hydrochloride | 1313584-92-7 | 2A-9093377 |
| 2-chloro-5-fluoro-4-methoxypyrimidine | 37554-70-4 | 2A-9093399 |
| 2-Methoxy-5-fluoro-4-aminopyrimidine | 1993-63-1 | 2A-9093400 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA