
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1849-76-9 |
| Catalog No. | 2A-9093311 |
| Chinese Name | 3-溴-5-氯-4-羟基苯甲醛 |
| Synonyms | 3-bromo-5-chloro-4-hydroxybenzaldehyde |
| Molecular Formula | C7H4BrClO2 |
| Molecular Weight | 235.46 |
| Density | 1.844g/cm3 |
| Boiling Point | 264.7ºC at 760 mmHg |
| Melting Point | 157-162°C |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2913000090 |
| PubChem ID | 5175975 |
| SMILES | O=Cc1cc(Cl)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H4BrClO2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
| InChI Key | ITSXSHQWMYYQQY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-carboxybenzediazonium tetrafluoroborate | 456-25-7 | 2A-9093305 |
| Taurodeoxycholic acid sodium salt monohydrate | 207737-97-1 | 2A-9093306 |
| GLYCOCHOLIC ACID SODIUM SALT HYDRATE | 338950-81-5 | 2A-9093307 |
| 3-Cyano-N-phenylbenzenesulfonamide | 56542-65-5 | 2A-9093309 |
| 5-(cyclopropylMethoxy)-1H-pyrazol-3-aMine | 852443-66-4 | 2A-9093310 |
| 5-(benzyloxy)-1H-pyrazol-3-aMine | 1000896-40-1 | 2A-9093314 |
| 4-METHYL-1-PENTYNE | 7154-75-8 | 2A-9093318 |
| 1,2-ETHANEDISULFONIC ACID DISODIUM SALT | 5325-43-9 | 2A-9093319 |
| DL-ARABINOSE | 20235-19-2 | 2A-9093320 |
| SELEXIPAG | 475086-01-2 | 2A-9093321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA