
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21888-98-2 |
| Catalog No. | 2A-9093210 |
| Chinese Name | 苄替米特 |
| Synonyms | Dexbenzetimide; DEXETIMIDE HCL; Dexbenzetimid; Dextrobenzetimide |
| Molecular Formula | C16H20O2N2 |
| Molecular Weight | 272.35 |
| Purity | 96% |
| Density | 1.178g/cm3 |
| Boiling Point | 543.9ºC at 760 mmHg |
| Melting Point | 181-183° |
| Storage Condition | Sealed in a cool, dry environment |
| Packaging | III |
| Application | Dexetimide ((+)-Benzetimide) is a high-affinity muscarinic receptor antagonist and potent and long-lasting anticholinergic that can be used to treat neurodepressant Parkinson's disease. |
| PubChem ID | 15399377 |
| MDL Number | MFCD32173676 |
| SMILES | O=C1CCC(c2ccccc2)(C2CCN(Cc3ccccc3)CC2)C(=O)N1 |
| InChI | InChI=1S/C23H26N2O2/c26-21-11-14-23(22(27)24-21,19-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18/h1-10,20H,11-17H2,(H,24,26,27)/t23-/m0/s1 |
| InChI Key | LQQIVYSCPWCSSD-HSZRJFAPSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/93210_1_21888_98_2.pdf |
| Transport Info | Product Name: Dexetimide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Pramlintide | 151126-32-8 | 2A-9093205 |
| BNP-32 (HUMAN) | 124584-08-3 | 2A-9093206 |
| Fertirelin acetate | 66002-66-2 | 2A-9093207 |
| SP-5 | 75957-60-7 | 2A-9093208 |
| 3-methylsulfanyl-2H-1,2,4-triazin-5-one | 18060-72-5 | 2A-9093209 |
| 6-EAPB | 1632539-47-9 | 2A-9093211 |
| Ethyl thiocarbamate | 637-98-9 | 2A-9093212 |
| Hematin | 14875-96-8 | 2A-9093213 |
| jadomycin B | 149633-99-8 | 2A-9093214 |
| Ro 19-8022 | 104604-66-2 | 2A-9093215 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA